r252659 - in collective.smartkeywordmanager/trunk: . collective/smartkeywordmanager collective/smartkeywordmanager/resources docs

"Tom Gross" <svn-changes-z4DKO/[email protected]> Mon, 28 Oct 2013 21:02:23 +0000 (UTC)
Newsgroups gmane.comp.web.zope.plone.collective.cvs
Message-ID <[email protected]>
Author: tom_gross
Date: Mon Oct 28 21:02:22 2013
New Revision: 252659

Added:
   collective.smartkeywordmanager/trunk/bootstrap.py
   collective.smartkeywordmanager/trunk/buildout.cfg
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/LICENSE
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/README.md
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/bower.json
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/release.sh
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2.css
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2.jquery.json
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2.min.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ar.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_bg.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ca.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_cs.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_da.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_de.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_el.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_en.js.template
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_es.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_et.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_eu.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_fa.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_fi.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_fr.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_gl.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_he.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_hr.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_hu.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_id.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_is.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_it.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ja.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ko.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_lt.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_lv.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_mk.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ms.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_nl.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_no.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_pl.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_pt-BR.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_pt-PT.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ro.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ru.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_sk.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_sv.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_th.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_tr.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ua.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_vi.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_zh-CN.js
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_zh-TW.js
Modified:
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/configure.zcml
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/smart_keyword_edit_form.pt
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/tests.py
   collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/views.py
   collective.smartkeywordmanager/trunk/docs/HISTORY.txt
Log:
added select2 widget for smart_keyword_edit_form


Added: collective.smartkeywordmanager/trunk/bootstrap.py
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/bootstrap.py	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,277 @@
+##############################################################################
+#
+# Copyright (c) 2006 Zope Foundation and Contributors.
+# All Rights Reserved.
+#
+# This software is subject to the provisions of the Zope Public License,
+# Version 2.1 (ZPL).  A copy of the ZPL should accompany this distribution.
+# THIS SOFTWARE IS PROVIDED "AS IS" AND ANY AND ALL EXPRESS OR IMPLIED
+# WARRANTIES ARE DISCLAIMED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+# WARRANTIES OF TITLE, MERCHANTABILITY, AGAINST INFRINGEMENT, AND FITNESS
+# FOR A PARTICULAR PURPOSE.
+#
+##############################################################################
+"""Bootstrap a buildout-based project
+
+Simply run this script in a directory containing a buildout.cfg.
+The script accepts buildout command-line options, so you can
+use the -c option to specify an alternate configuration file.
+"""
+
+import os, shutil, sys, tempfile, urllib, urllib2, subprocess
+from optparse import OptionParser
+
+if sys.platform == 'win32':
+    def quote(c):
+        if ' ' in c:
+            return '"%s"' % c  # work around spawn lamosity on windows
+        else:
+            return c
+else:
+    quote = str
+
+# See zc.buildout.easy_install._has_broken_dash_S for motivation and comments.
+stdout, stderr = subprocess.Popen(
+    [sys.executable, '-Sc',
+     'try:\n'
+     '    import ConfigParser\n'
+     'except ImportError:\n'
+     '    print 1\n'
+     'else:\n'
+     '    print 0\n'],
+    stdout=subprocess.PIPE, stderr=subprocess.PIPE).communicate()
+has_broken_dash_S = bool(int(stdout.strip()))
+
+# In order to be more robust in the face of system Pythons, we want to
+# run without site-packages loaded.  This is somewhat tricky, in
+# particular because Python 2.6's distutils imports site, so starting
+# with the -S flag is not sufficient.  However, we'll start with that:
+if not has_broken_dash_S and 'site' in sys.modules:
+    # We will restart with python -S.
+    args = sys.argv[:]
+    args[0:0] = [sys.executable, '-S']
+    args = map(quote, args)
+    os.execv(sys.executable, args)
+# Now we are running with -S.  We'll get the clean sys.path, import site
+# because distutils will do it later, and then reset the path and clean
+# out any namespace packages from site-packages that might have been
+# loaded by .pth files.
+clean_path = sys.path[:]
+import site  # imported because of its side effects
+sys.path[:] = clean_path
+for k, v in sys.modules.items():
+    if k in ('setuptools', 'pkg_resources') or (
+        hasattr(v, '__path__') and
+        len(v.__path__) == 1 and
+        not os.path.exists(os.path.join(v.__path__[0], '__init__.py'))):
+        # This is a namespace package.  Remove it.
+        sys.modules.pop(k)
+
+is_jython = sys.platform.startswith('java')
+
+setuptools_source = 'http://peak.telecommunity.com/dist/ez_setup.py'
+distribute_source = 'http://python-distribute.org/distribute_setup.py'
+
+
+# parsing arguments
+def normalize_to_url(option, opt_str, value, parser):
+    if value:
+        if '://' not in value:  # It doesn't smell like a URL.
+            value = 'file://%s' % (
+                urllib.pathname2url(
+                    os.path.abspath(os.path.expanduser(value))),)
+        if opt_str == '--download-base' and not value.endswith('/'):
+            # Download base needs a trailing slash to make the world happy.
+            value += '/'
+    else:
+        value = None
+    name = opt_str[2:].replace('-', '_')
+    setattr(parser.values, name, value)
+
+usage = '''\
+[DESIRED PYTHON FOR BUILDOUT] bootstrap.py [options]
+
+Bootstraps a buildout-based project.
+
+Simply run this script in a directory containing a buildout.cfg, using the
+Python that you want bin/buildout to use.
+
+Note that by using --setup-source and --download-base to point to
+local resources, you can keep this script from going over the network.
+'''
+
+parser = OptionParser(usage=usage)
+parser.add_option("-v", "--version", dest="version",
+                          help="use a specific zc.buildout version")
+parser.add_option("-d", "--distribute",
+                   action="store_true", dest="use_distribute", default=False,
+                   help="Use Distribute rather than Setuptools.")
+parser.add_option("--setup-source", action="callback", dest="setup_source",
+                  callback=normalize_to_url, nargs=1, type="string",
+                  help=("Specify a URL or file location for the setup file. "
+                        "If you use Setuptools, this will default to " +
+                        setuptools_source + "; if you use Distribute, this "
+                        "will default to " + distribute_source + "."))
+parser.add_option("--download-base", action="callback", dest="download_base",
+                  callback=normalize_to_url, nargs=1, type="string",
+                  help=("Specify a URL or directory for downloading "
+                        "zc.buildout and either Setuptools or Distribute. "
+                        "Defaults to PyPI."))
+parser.add_option("--eggs",
+                  help=("Specify a directory for storing eggs.  Defaults to "
+                        "a temporary directory that is deleted when the "
+                        "bootstrap script completes."))
+parser.add_option("-t", "--accept-buildout-test-releases",
+                  dest='accept_buildout_test_releases',
+                  action="store_true", default=False,
+                  help=("Normally, if you do not specify a --version, the "
+                        "bootstrap script and buildout gets the newest "
+                        "*final* versions of zc.buildout and its recipes and "
+                        "extensions for you.  If you use this flag, "
+                        "bootstrap and buildout will get the newest releases "
+                        "even if they are alphas or betas."))
+parser.add_option("-c", None, action="store", dest="config_file",
+                   help=("Specify the path to the buildout configuration "
+                         "file to be used."))
+
+options, args = parser.parse_args()
+
+if options.eggs:
+    eggs_dir = os.path.abspath(os.path.expanduser(options.eggs))
+else:
+    eggs_dir = tempfile.mkdtemp()
+
+if options.setup_source is None:
+    if options.use_distribute:
+        options.setup_source = distribute_source
+    else:
+        options.setup_source = setuptools_source
+
+if options.accept_buildout_test_releases:
+    args.insert(0, 'buildout:accept-buildout-test-releases=true')
+
+try:
+    import pkg_resources
+    import setuptools  # A flag.  Sometimes pkg_resources is installed alone.
+    if not hasattr(pkg_resources, '_distribute'):
+        raise ImportError
+except ImportError:
+    ez_code = urllib2.urlopen(
+        options.setup_source).read().replace('\r\n', '\n')
+    ez = {}
+    exec ez_code in ez
+    setup_args = dict(to_dir=eggs_dir, download_delay=0)
+    if options.download_base:
+        setup_args['download_base'] = options.download_base
+    if options.use_distribute:
+        setup_args['no_fake'] = True
+        if sys.version_info[:2] == (2, 4):
+            setup_args['version'] = '0.6.32'
+    ez['use_setuptools'](**setup_args)
+    if 'pkg_resources' in sys.modules:
+        reload(sys.modules['pkg_resources'])
+    import pkg_resources
+    # This does not (always?) update the default working set.  We will
+    # do it.
+    for path in sys.path:
+        if path not in pkg_resources.working_set.entries:
+            pkg_resources.working_set.add_entry(path)
+
+cmd = [quote(sys.executable),
+       '-c',
+       quote('from setuptools.command.easy_install import main; main()'),
+       '-mqNxd',
+       quote(eggs_dir)]
+
+if not has_broken_dash_S:
+    cmd.insert(1, '-S')
+
+find_links = options.download_base
+if not find_links:
+    find_links = os.environ.get('bootstrap-testing-find-links')
+if not find_links and options.accept_buildout_test_releases:
+    find_links = 'http://downloads.buildout.org/'
+if find_links:
+    cmd.extend(['-f', quote(find_links)])
+
+if options.use_distribute:
+    setup_requirement = 'distribute'
+else:
+    setup_requirement = 'setuptools'
+ws = pkg_resources.working_set
+setup_requirement_path = ws.find(
+    pkg_resources.Requirement.parse(setup_requirement)).location
+env = dict(
+    os.environ,
+    PYTHONPATH=setup_requirement_path)
+
+requirement = 'zc.buildout'
+version = options.version
+if version is None and not options.accept_buildout_test_releases:
+    # Figure out the most recent final version of zc.buildout.
+    import setuptools.package_index
+    _final_parts = '*final-', '*final'
+
+    def _final_version(parsed_version):
+        for part in parsed_version:
+            if (part[:1] == '*') and (part not in _final_parts):
+                return False
+        return True
+    index = setuptools.package_index.PackageIndex(
+        search_path=[setup_requirement_path])
+    if find_links:
+        index.add_find_links((find_links,))
+    req = pkg_resources.Requirement.parse(requirement)
+    if index.obtain(req) is not None:
+        best = []
+        bestv = None
+        for dist in index[req.project_name]:
+            distv = dist.parsed_version
+            if distv >= pkg_resources.parse_version('2dev'):
+                continue
+            if _final_version(distv):
+                if bestv is None or distv > bestv:
+                    best = [dist]
+                    bestv = distv
+                elif distv == bestv:
+                    best.append(dist)
+        if best:
+            best.sort()
+            version = best[-1].version
+
+if version:
+    requirement += '=='+version
+else:
+    requirement += '<2dev'
+
+cmd.append(requirement)
+
+if is_jython:
+    import subprocess
+    exitcode = subprocess.Popen(cmd, env=env).wait()
+else:  # Windows prefers this, apparently; otherwise we would prefer subprocess
+    exitcode = os.spawnle(*([os.P_WAIT, sys.executable] + cmd + [env]))
+if exitcode != 0:
+    sys.stdout.flush()
+    sys.stderr.flush()
+    print ("An error occurred when trying to install zc.buildout. "
+           "Look above this message for any errors that "
+           "were output by easy_install.")
+    sys.exit(exitcode)
+
+ws.add_entry(eggs_dir)
+ws.require(requirement)
+import zc.buildout.buildout
+
+# If there isn't already a command in the args, add bootstrap
+if not [a for a in args if '=' not in a]:
+    args.append('bootstrap')
+
+
+# if -c was provided, we push it back into args for buildout's main function
+if options.config_file is not None:
+    args[0:0] = ['-c', options.config_file]
+
+zc.buildout.buildout.main(args)
+if not options.eggs:  # clean up temporary egg directory
+    shutil.rmtree(eggs_dir)

Added: collective.smartkeywordmanager/trunk/buildout.cfg
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/buildout.cfg	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,18 @@
+[buildout]
+extends =
+    https://raw.github.com/collective/buildout.plonetest/master/test-4.3.x.cfg
+package-name = collective.smartkeywordmanager
+
+[zestreleaser]
+recipe = zc.recipe.egg:scripts
+eggs =  
+   zest.releaser
+   Products.TinyMCE [test,docs]
+
+[test-coverage]
+recipe = zc.recipe.testrunner
+eggs =
+    collective.smartkeywordmanager
+    Pillow
+defaults = ['--coverage', '../../coverage', '-v', '--auto-progress', '-s', 'collective.smartkeywordmanager']
+

Modified: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/configure.zcml
==============================================================================
--- collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/configure.zcml	(original)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/configure.zcml	Mon Oct 28 21:02:22 2013
@@ -24,6 +24,12 @@
       permission="zope2.View"
       />
 
+   <!-- Resource directory -->
+   <browser:resourceDirectory
+        name="collective.smartkeywordmanager"
+        directory="resources"
+        />
+
   <include package="plone.app.registry" />
 
   <genericsetup:registerProfile

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/LICENSE
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/LICENSE	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,18 @@
+Copyright 2012 Igor Vaynberg
+
+Version: @@ver@@ Timestamp: @@timestamp@@
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License at:
+
+http://www.apache.org/licenses/LICENSE-2.0
+http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the Apache License
+or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
+either express or implied. See the Apache License and the GPL License for the specific language governing
+permissions and limitations under the Apache License and the GPL License.
\ No newline at end of file

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/README.md
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/README.md	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,83 @@
+Select2
+=======
+
+Select2 is a jQuery-based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.
+
+To get started, checkout examples and documentation at http://ivaynberg.github.com/select2
+
+Use cases
+---------
+
+* Enhancing native selects with search.
+* Enhancing native selects with a better multi-select interface.
+* Loading data from JavaScript: easily load items via ajax and have them searchable.
+* Nesting optgroups: native selects only support one level of nested. Select2 does not have this restriction.
+* Tagging: ability to add new items on the fly.
+* Working with large, remote datasets: ability to partially load a dataset based on the search term.
+* Paging of large datasets: easy support for loading more pages when the results are scrolled to the end.
+* Templating: support for custom rendering of results and selections.
+
+Browser compatibility
+---------------------
+* IE 8+
+* Chrome 8+
+* Firefox 10+
+* Safari 3+
+* Opera 10.6+
+
+Integrations
+------------
+
+* [Wicket-Select2](https://github.com/ivaynberg/wicket-select2) (Java / [Apache Wicket](http://wicket.apache.org))
+* [select2-rails](https://github.com/argerim/select2-rails) (Ruby on Rails)
+* [AngularUI](http://angular-ui.github.com/#directives-select2) ([AngularJS](angularjs.org))
+* [Django](https://github.com/applegrew/django-select2)
+* [Symfony](https://github.com/19Gerhard85/sfSelect2WidgetsPlugin)
+* [Bootstrap](https://github.com/t0m/select2-bootstrap-css) (CSS skin)
+* [Yii](https://github.com/tonybolzan/yii-select2)
+
+Internationalization (i18n)
+---------------------------
+
+Select2 supports multiple languages by simply including the right
+language JS file (`select2_locale_it.js`, `select2_locale_nl.js`, etc.).
+
+Missing a language? Just copy `select2_locale_en.js.template`, translate
+it, and make a pull request back to Select2 here on GitHub.
+
+Bug tracker
+-----------
+
+Have a bug? Please create an issue here on GitHub!
+
+https://github.com/ivaynberg/select2/issues
+
+Mailing list
+------------
+
+Have a question? Ask on our mailing list!
+
[email protected]
+
+https://groups.google.com/d/forum/select2
+
+
+Copyright and license
+---------------------
+
+Copyright 2012 Igor Vaynberg
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License in the LICENSE file, or at:
+
+http://www.apache.org/licenses/LICENSE-2.0
+http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the Apache License
+or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
+either express or implied. See the Apache License and the GPL License for the specific language governing
+permissions and limitations under the Apache License and the GPL License.

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/bower.json
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/bower.json	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,8 @@
+{
+    "name": "select2",
+    "version": "3.4.3",
+    "main": ["select2.js", "select2.css", "select2.png", "select2x2.png", "select2-spinner.gif"],
+    "dependencies": {
+        "jquery": ">= 1.7.1"
+    }
+}

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/release.sh
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/release.sh	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,69 @@
+#!/bin/bash
+set -e
+
+echo -n "Enter the version for this release: "
+
+read ver
+
+if [ ! $ver ]; then 
+	echo "Invalid version."
+	exit
+fi
+
+name="select2"
+js="$name.js"
+mini="$name.min.js"
+css="$name.css"
+release="$name-$ver"
+tag="$ver"
+branch="build-$ver"
+curbranch=`git branch | grep "*" | sed "s/* //"`
+timestamp=$(date)
+tokens="s/@@ver@@/$ver/g;s/\@@timestamp@@/$timestamp/g"
+remote="github"
+
+echo "Updating Version Identifiers"
+
+sed -E -e "s/\"version\": \"([0-9\.]+)\",/\"version\": \"$ver\",/g" -i "" bower.json select2.jquery.json
+git add bower.json
+git add select2.jquery.json
+git commit -m "modified version identifiers in descriptors for release $ver"
+git push
+ 
+git branch "$branch"
+git checkout "$branch"
+
+echo "Tokenizing..."
+
+find . -name "$js" | xargs -I{} sed -e "$tokens" -i "" {} 
+find . -name "$css" | xargs -I{} sed -e "$tokens" -i "" {}
+sed -e "s/latest/$ver/g" -i "" bower.json
+
+git add "$js"
+git add "$css"
+
+echo "Minifying..."
+
+echo "/*" > "$mini"
+cat LICENSE | sed "$tokens" >> "$mini"
+echo "*/" >> "$mini"
+
+curl -s \
+	--data-urlencode "js_code@$js" \
+	http://marijnhaverbeke.nl/uglifyjs \
+	>> "$mini"
+
+git add "$mini"
+	
+git commit -m "release $ver"
+
+echo "Tagging..."
+git tag -a "$tag" -m "tagged version $ver"
+git push "$remote" --tags
+
+echo "Cleaning Up..."
+
+git checkout "$curbranch"
+git branch -D "$branch"
+
+echo "Done"

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2.css
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2.css	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,615 @@
+/*
+Version: 3.4.3 Timestamp: Tue Sep 17 06:47:14 PDT 2013
+*/
+.select2-container {
+    margin: 0;
+    position: relative;
+    display: inline-block;
+    /* inline-block for ie7 */
+    zoom: 1;
+    *display: inline;
+    vertical-align: middle;
+}
+
+.select2-container,
+.select2-drop,
+.select2-search,
+.select2-search input {
+  /*
+    Force border-box so that % widths fit the parent
+    container without overlap because of margin/padding.
+
+    More Info : http://www.quirksmode.org/css/box.html
+  */
+  -webkit-box-sizing: border-box; /* webkit */
+     -moz-box-sizing: border-box; /* firefox */
+          box-sizing: border-box; /* css3 */
+}
+
+.select2-container .select2-choice {
+    display: block;
+    height: 26px;
+    padding: 0 0 0 8px;
+    overflow: hidden;
+    position: relative;
+
+    border: 1px solid #aaa;
+    white-space: nowrap;
+    line-height: 26px;
+    color: #444;
+    text-decoration: none;
+
+    border-radius: 4px;
+
+    background-clip: padding-box;
+
+    -webkit-touch-callout: none;
+      -webkit-user-select: none;
+         -moz-user-select: none;
+          -ms-user-select: none;
+              user-select: none;
+
+    background-color: #fff;
+    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
+    background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
+    background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
+    background-image: linear-gradient(top, #fff 0%, #eee 50%);
+}
+
+.select2-container.select2-drop-above .select2-choice {
+    border-bottom-color: #aaa;
+
+    border-radius: 0 0 4px 4px;
+
+    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
+    background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
+    background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
+    background-image: linear-gradient(top, #eee 0%, #fff 90%);
+}
+
+.select2-container.select2-allowclear .select2-choice .select2-chosen {
+    margin-right: 42px;
+}
+
+.select2-container .select2-choice > .select2-chosen {
+    margin-right: 26px;
+    display: block;
+    overflow: hidden;
+
+    white-space: nowrap;
+
+    text-overflow: ellipsis;
+}
+
+.select2-container .select2-choice abbr {
+    display: none;
+    width: 12px;
+    height: 12px;
+    position: absolute;
+    right: 24px;
+    top: 8px;
+
+    font-size: 1px;
+    text-decoration: none;
+
+    border: 0;
+    background: url('select2.png') right top no-repeat;
+    cursor: pointer;
+    outline: 0;
+}
+
+.select2-container.select2-allowclear .select2-choice abbr {
+    display: inline-block;
+}
+
+.select2-container .select2-choice abbr:hover {
+    background-position: right -11px;
+    cursor: pointer;
+}
+
+.select2-drop-mask {
+    border: 0;
+    margin: 0;
+    padding: 0;
+    position: fixed;
+    left: 0;
+    top: 0;
+    min-height: 100%;
+    min-width: 100%;
+    height: auto;
+    width: auto;
+    opacity: 0;
+    z-index: 9998;
+    /* styles required for IE to work */
+    background-color: #fff;
+    filter: alpha(opacity=0);
+}
+
+.select2-drop {
+    width: 100%;
+    margin-top: -1px;
+    position: absolute;
+    z-index: 9999;
+    top: 100%;
+
+    background: #fff;
+    color: #000;
+    border: 1px solid #aaa;
+    border-top: 0;
+
+    border-radius: 0 0 4px 4px;
+
+    -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
+            box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
+}
+
+.select2-drop-auto-width {
+    border-top: 1px solid #aaa;
+    width: auto;
+}
+
+.select2-drop-auto-width .select2-search {
+    padding-top: 4px;
+}
+
+.select2-drop.select2-drop-above {
+    margin-top: 1px;
+    border-top: 1px solid #aaa;
+    border-bottom: 0;
+
+    border-radius: 4px 4px 0 0;
+
+    -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
+            box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
+}
+
+.select2-drop-active {
+    border: 1px solid #5897fb;
+    border-top: none;
+}
+
+.select2-drop.select2-drop-above.select2-drop-active {
+    border-top: 1px solid #5897fb;
+}
+
+.select2-container .select2-choice .select2-arrow {
+    display: inline-block;
+    width: 18px;
+    height: 100%;
+    position: absolute;
+    right: 0;
+    top: 0;
+
+    border-left: 1px solid #aaa;
+    border-radius: 0 4px 4px 0;
+
+    background-clip: padding-box;
+
+    background: #ccc;
+    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
+    background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
+    background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
+    background-image: linear-gradient(top, #ccc 0%, #eee 60%);
+}
+
+.select2-container .select2-choice .select2-arrow b {
+    display: block;
+    width: 100%;
+    height: 100%;
+    background: url('select2.png') no-repeat 0 1px;
+}
+
+.select2-search {
+    display: inline-block;
+    width: 100%;
+    min-height: 26px;
+    margin: 0;
+    padding-left: 4px;
+    padding-right: 4px;
+
+    position: relative;
+    z-index: 10000;
+
+    white-space: nowrap;
+}
+
+.select2-search input {
+    width: 100%;
+    height: auto !important;
+    min-height: 26px;
+    padding: 4px 20px 4px 5px;
+    margin: 0;
+
+    outline: 0;
+    font-family: sans-serif;
+    font-size: 1em;
+
+    border: 1px solid #aaa;
+    border-radius: 0;
+
+    -webkit-box-shadow: none;
+            box-shadow: none;
+
+    background: #fff url('select2.png') no-repeat 100% -22px;
+    background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
+    background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
+    background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
+    background: url('select2.png') no-repeat 100% -22px, linear-gradient(top, #fff 85%, #eee 99%);
+}
+
+.select2-drop.select2-drop-above .select2-search input {
+    margin-top: 4px;
+}
+
+.select2-search input.select2-active {
+    background: #fff url('select2-spinner.gif') no-repeat 100%;
+    background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
+    background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
+    background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
+    background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(top, #fff 85%, #eee 99%);
+}
+
+.select2-container-active .select2-choice,
+.select2-container-active .select2-choices {
+    border: 1px solid #5897fb;
+    outline: none;
+
+    -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
+            box-shadow: 0 0 5px rgba(0, 0, 0, .3);
+}
+
+.select2-dropdown-open .select2-choice {
+    border-bottom-color: transparent;
+    -webkit-box-shadow: 0 1px 0 #fff inset;
+            box-shadow: 0 1px 0 #fff inset;
+
+    border-bottom-left-radius: 0;
+    border-bottom-right-radius: 0;
+
+    background-color: #eee;
+    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
+    background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
+    background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
+    background-image: linear-gradient(top, #fff 0%, #eee 50%);
+}
+
+.select2-dropdown-open.select2-drop-above .select2-choice,
+.select2-dropdown-open.select2-drop-above .select2-choices {
+    border: 1px solid #5897fb;
+    border-top-color: transparent;
+
+    background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
+    background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
+    background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
+    background-image: linear-gradient(bottom, #fff 0%, #eee 50%);
+}
+
+.select2-dropdown-open .select2-choice .select2-arrow {
+    background: transparent;
+    border-left: none;
+    filter: none;
+}
+.select2-dropdown-open .select2-choice .select2-arrow b {
+    background-position: -18px 1px;
+}
+
+/* results */
+.select2-results {
+    max-height: 200px;
+    padding: 0 0 0 4px;
+    margin: 4px 4px 4px 0;
+    position: relative;
+    overflow-x: hidden;
+    overflow-y: auto;
+    -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
+}
+
+.select2-results ul.select2-result-sub {
+    margin: 0;
+    padding-left: 0;
+}
+
+.select2-results ul.select2-result-sub > li .select2-result-label { padding-left: 20px }
+.select2-results ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 40px }
+.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 60px }
+.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 80px }
+.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 100px }
+.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 110px }
+.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 120px }
+
+.select2-results li {
+    list-style: none;
+    display: list-item;
+    background-image: none;
+}
+
+.select2-results li.select2-result-with-children > .select2-result-label {
+    font-weight: bold;
+}
+
+.select2-results .select2-result-label {
+    padding: 3px 7px 4px;
+    margin: 0;
+    cursor: pointer;
+
+    min-height: 1em;
+
+    -webkit-touch-callout: none;
+      -webkit-user-select: none;
+         -moz-user-select: none;
+          -ms-user-select: none;
+              user-select: none;
+}
+
+.select2-results .select2-highlighted {
+    background: #3875d7;
+    color: #fff;
+}
+
+.select2-results li em {
+    background: #feffde;
+    font-style: normal;
+}
+
+.select2-results .select2-highlighted em {
+    background: transparent;
+}
+
+.select2-results .select2-highlighted ul {
+    background: #fff;
+    color: #000;
+}
+
+
+.select2-results .select2-no-results,
+.select2-results .select2-searching,
+.select2-results .select2-selection-limit {
+    background: #f4f4f4;
+    display: list-item;
+}
+
+/*
+disabled look for disabled choices in the results dropdown
+*/
+.select2-results .select2-disabled.select2-highlighted {
+    color: #666;
+    background: #f4f4f4;
+    display: list-item;
+    cursor: default;
+}
+.select2-results .select2-disabled {
+  background: #f4f4f4;
+  display: list-item;
+  cursor: default;
+}
+
+.select2-results .select2-selected {
+    display: none;
+}
+
+.select2-more-results.select2-active {
+    background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
+}
+
+.select2-more-results {
+    background: #f4f4f4;
+    display: list-item;
+}
+
+/* disabled styles */
+
+.select2-container.select2-container-disabled .select2-choice {
+    background-color: #f4f4f4;
+    background-image: none;
+    border: 1px solid #ddd;
+    cursor: default;
+}
+
+.select2-container.select2-container-disabled .select2-choice .select2-arrow {
+    background-color: #f4f4f4;
+    background-image: none;
+    border-left: 0;
+}
+
+.select2-container.select2-container-disabled .select2-choice abbr {
+    display: none;
+}
+
+
+/* multiselect */
+
+.select2-container-multi .select2-choices {
+    height: auto !important;
+    height: 1%;
+    margin: 0;
+    padding: 0;
+    position: relative;
+
+    border: 1px solid #aaa;
+    cursor: text;
+    overflow: hidden;
+
+    background-color: #fff;
+    background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
+    background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
+    background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
+    background-image: linear-gradient(top, #eee 1%, #fff 15%);
+}
+
+.select2-locked {
+  padding: 3px 5px 3px 5px !important;
+}
+
+.select2-container-multi .select2-choices {
+    min-height: 26px;
+}
+
+.select2-container-multi.select2-container-active .select2-choices {
+    border: 1px solid #5897fb;
+    outline: none;
+
+    -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
+            box-shadow: 0 0 5px rgba(0, 0, 0, .3);
+}
+.select2-container-multi .select2-choices li {
+    float: left;
+    list-style: none;
+}
+.select2-container-multi .select2-choices .select2-search-field {
+    margin: 0;
+    padding: 0;
+    white-space: nowrap;
+}
+
+.select2-container-multi .select2-choices .select2-search-field input {
+    padding: 5px;
+    margin: 1px 0;
+
+    font-family: sans-serif;
+    font-size: 100%;
+    color: #666;
+    outline: 0;
+    border: 0;
+    -webkit-box-shadow: none;
+            box-shadow: none;
+    background: transparent !important;
+}
+
+.select2-container-multi .select2-choices .select2-search-field input.select2-active {
+    background: #fff url('select2-spinner.gif') no-repeat 100% !important;
+}
+
+.select2-default {
+    color: #999 !important;
+}
+
+.select2-container-multi .select2-choices .select2-search-choice {
+    padding: 3px 5px 3px 18px;
+    margin: 3px 0 3px 5px;
+    position: relative;
+
+    line-height: 13px;
+    color: #333;
+    cursor: default;
+    border: 1px solid #aaaaaa;
+
+    border-radius: 3px;
+
+    -webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
+            box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
+
+    background-clip: padding-box;
+
+    -webkit-touch-callout: none;
+      -webkit-user-select: none;
+         -moz-user-select: none;
+          -ms-user-select: none;
+              user-select: none;
+
+    background-color: #e4e4e4;
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
+    background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
+    background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
+    background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
+    background-image: linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
+}
+.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
+    cursor: default;
+}
+.select2-container-multi .select2-choices .select2-search-choice-focus {
+    background: #d4d4d4;
+}
+
+.select2-search-choice-close {
+    display: block;
+    width: 12px;
+    height: 13px;
+    position: absolute;
+    right: 3px;
+    top: 4px;
+
+    font-size: 1px;
+    outline: none;
+    background: url('select2.png') right top no-repeat;
+}
+
+.select2-container-multi .select2-search-choice-close {
+    left: 3px;
+}
+
+.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
+  background-position: right -11px;
+}
+.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
+    background-position: right -11px;
+}
+
+/* disabled styles */
+.select2-container-multi.select2-container-disabled .select2-choices {
+    background-color: #f4f4f4;
+    background-image: none;
+    border: 1px solid #ddd;
+    cursor: default;
+}
+
+.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
+    padding: 3px 5px 3px 5px;
+    border: 1px solid #ddd;
+    background-image: none;
+    background-color: #f4f4f4;
+}
+
+.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close {    display: none;
+    background: none;
+}
+/* end multiselect */
+
+
+.select2-result-selectable .select2-match,
+.select2-result-unselectable .select2-match {
+    text-decoration: underline;
+}
+
+.select2-offscreen, .select2-offscreen:focus {
+    clip: rect(0 0 0 0) !important;
+    width: 1px !important;
+    height: 1px !important;
+    border: 0 !important;
+    margin: 0 !important;
+    padding: 0 !important;
+    overflow: hidden !important;
+    position: absolute !important;
+    outline: 0 !important;
+    left: 0px !important;
+    top: 0px !important;
+}
+
+.select2-display-none {
+    display: none;
+}
+
+.select2-measure-scrollbar {
+    position: absolute;
+    top: -10000px;
+    left: -10000px;
+    width: 100px;
+    height: 100px;
+    overflow: scroll;
+}
+/* Retina-ize icons */
+
+@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 144dpi)  {
+  .select2-search input, .select2-search-choice-close, .select2-container .select2-choice abbr, .select2-container .select2-choice .select2-arrow b {
+      background-image: url('select2x2.png') !important;
+      background-repeat: no-repeat !important;
+      background-size: 60px 40px !important;
+  }
+  .select2-search input {
+      background-position: 100% -21px !important;
+  }
+}

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2.jquery.json
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2.jquery.json	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,36 @@
+{
+    "name": "select2",
+    "title": "Select2",
+    "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
+    "keywords": [
+        "select",
+        "autocomplete",
+        "typeahead",
+        "dropdown",
+        "multiselect",
+        "tag",
+        "tagging"
+    ],
+    "version": "3.4.3",
+    "author": {
+        "name": "Igor Vaynberg",
+        "url": "https://github.com/ivaynberg"
+    },
+    "licenses": [
+        {
+            "type": "Apache",
+            "url": "http://www.apache.org/licenses/LICENSE-2.0"
+        },
+        {
+            "type": "GPL v2",
+            "url": "http://www.gnu.org/licenses/gpl-2.0.html"
+        }
+    ],
+    "bugs": "https://github.com/ivaynberg/select2/issues",
+    "homepage": "http://ivaynberg.github.com/select2",
+    "docs": "http://ivaynberg.github.com/select2/",
+    "download": "https://github.com/ivaynberg/select2/tags",
+    "dependencies": {
+        "jquery": ">=1.7.1"
+    }
+}

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,3217 @@
+/*
+Copyright 2012 Igor Vaynberg
+
+Version: 3.4.3 Timestamp: Tue Sep 17 06:47:14 PDT 2013
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License at:
+
+    http://www.apache.org/licenses/LICENSE-2.0
+    http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the
+Apache License or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
+CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
+the specific language governing permissions and limitations under the Apache License and the GPL License.
+*/
+(function ($) {
+    if(typeof $.fn.each2 == "undefined") {
+        $.extend($.fn, {
+            /*
+            * 4-10 times faster .each replacement
+            * use it carefully, as it overrides jQuery context of element on each iteration
+            */
+            each2 : function (c) {
+                var j = $([0]), i = -1, l = this.length;
+                while (
+                    ++i < l
+                    && (j.context = j[0] = this[i])
+                    && c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
+                );
+                return this;
+            }
+        });
+    }
+})(jQuery);
+
+(function ($, undefined) {
+    "use strict";
+    /*global document, window, jQuery, console */
+
+    if (window.Select2 !== undefined) {
+        return;
+    }
+
+    var KEY, AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
+        lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
+
+    KEY = {
+        TAB: 9,
+        ENTER: 13,
+        ESC: 27,
+        SPACE: 32,
+        LEFT: 37,
+        UP: 38,
+        RIGHT: 39,
+        DOWN: 40,
+        SHIFT: 16,
+        CTRL: 17,
+        ALT: 18,
+        PAGE_UP: 33,
+        PAGE_DOWN: 34,
+        HOME: 36,
+        END: 35,
+        BACKSPACE: 8,
+        DELETE: 46,
+        isArrow: function (k) {
+            k = k.which ? k.which : k;
+            switch (k) {
+            case KEY.LEFT:
+            case KEY.RIGHT:
+            case KEY.UP:
+            case KEY.DOWN:
+                return true;
+            }
+            return false;
+        },
+        isControl: function (e) {
+            var k = e.which;
+            switch (k) {
+            case KEY.SHIFT:
+            case KEY.CTRL:
+            case KEY.ALT:
+                return true;
+            }
+
+            if (e.metaKey) return true;
+
+            return false;
+        },
+        isFunctionKey: function (k) {
+            k = k.which ? k.which : k;
+            return k >= 112 && k <= 123;
+        }
+    },
+    MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
+
+    DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D",
 "\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"
 I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6
 ":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E
 66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1
 E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":
 "b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260"
 :"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D
 ":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA
 755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u0
 1B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z"};
+
+    $document = $(document);
+
+    nextUid=(function() { var counter=1; return function() { return counter++; }; }());
+
+
+    function stripDiacritics(str) {
+        var ret, i, l, c;
+
+        if (!str || str.length < 1) return str;
+
+        ret = "";
+        for (i = 0, l = str.length; i < l; i++) {
+            c = str.charAt(i);
+            ret += DIACRITICS[c] || c;
+        }
+        return ret;
+    }
+
+    function indexOf(value, array) {
+        var i = 0, l = array.length;
+        for (; i < l; i = i + 1) {
+            if (equal(value, array[i])) return i;
+        }
+        return -1;
+    }
+
+    function measureScrollbar () {
+        var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
+        $template.appendTo('body');
+
+        var dim = {
+            width: $template.width() - $template[0].clientWidth,
+            height: $template.height() - $template[0].clientHeight
+        };
+        $template.remove();
+
+        return dim;
+    }
+
+    /**
+     * Compares equality of a and b
+     * @param a
+     * @param b
+     */
+    function equal(a, b) {
+        if (a === b) return true;
+        if (a === undefined || b === undefined) return false;
+        if (a === null || b === null) return false;
+        // Check whether 'a' or 'b' is a string (primitive or object).
+        // The concatenation of an empty string (+'') converts its argument to a string's primitive.
+        if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
+        if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
+        return false;
+    }
+
+    /**
+     * Splits the string into an array of values, trimming each value. An empty array is returned for nulls or empty
+     * strings
+     * @param string
+     * @param separator
+     */
+    function splitVal(string, separator) {
+        var val, i, l;
+        if (string === null || string.length < 1) return [];
+        val = string.split(separator);
+        for (i = 0, l = val.length; i < l; i = i + 1) val[i] = $.trim(val[i]);
+        return val;
+    }
+
+    function getSideBorderPadding(element) {
+        return element.outerWidth(false) - element.width();
+    }
+
+    function installKeyUpChangeEvent(element) {
+        var key="keyup-change-value";
+        element.on("keydown", function () {
+            if ($.data(element, key) === undefined) {
+                $.data(element, key, element.val());
+            }
+        });
+        element.on("keyup", function () {
+            var val= $.data(element, key);
+            if (val !== undefined && element.val() !== val) {
+                $.removeData(element, key);
+                element.trigger("keyup-change");
+            }
+        });
+    }
+
+    $document.on("mousemove", function (e) {
+        lastMousePosition.x = e.pageX;
+        lastMousePosition.y = e.pageY;
+    });
+
+    /**
+     * filters mouse events so an event is fired only if the mouse moved.
+     *
+     * filters out mouse events that occur when mouse is stationary but
+     * the elements under the pointer are scrolled.
+     */
+    function installFilteredMouseMove(element) {
+        element.on("mousemove", function (e) {
+            var lastpos = lastMousePosition;
+            if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
+                $(e.target).trigger("mousemove-filtered", e);
+            }
+        });
+    }
+
+    /**
+     * Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
+     * within the last quietMillis milliseconds.
+     *
+     * @param quietMillis number of milliseconds to wait before invoking fn
+     * @param fn function to be debounced
+     * @param ctx object to be used as this reference within fn
+     * @return debounced version of fn
+     */
+    function debounce(quietMillis, fn, ctx) {
+        ctx = ctx || undefined;
+        var timeout;
+        return function () {
+            var args = arguments;
+            window.clearTimeout(timeout);
+            timeout = window.setTimeout(function() {
+                fn.apply(ctx, args);
+            }, quietMillis);
+        };
+    }
+
+    /**
+     * A simple implementation of a thunk
+     * @param formula function used to lazily initialize the thunk
+     * @return {Function}
+     */
+    function thunk(formula) {
+        var evaluated = false,
+            value;
+        return function() {
+            if (evaluated === false) { value = formula(); evaluated = true; }
+            return value;
+        };
+    };
+
+    function installDebouncedScroll(threshold, element) {
+        var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
+        element.on("scroll", function (e) {
+            if (indexOf(e.target, element.get()) >= 0) notify(e);
+        });
+    }
+
+    function focus($el) {
+        if ($el[0] === document.activeElement) return;
+
+        /* set the focus in a 0 timeout - that way the focus is set after the processing
+            of the current event has finished - which seems like the only reliable way
+            to set focus */
+        window.setTimeout(function() {
+            var el=$el[0], pos=$el.val().length, range;
+
+            $el.focus();
+
+            /* make sure el received focus so we do not error out when trying to manipulate the caret.
+                sometimes modals or others listeners may steal it after its set */
+            if ($el.is(":visible") && el === document.activeElement) {
+
+                /* after the focus is set move the caret to the end, necessary when we val()
+                    just before setting focus */
+                if(el.setSelectionRange)
+                {
+                    el.setSelectionRange(pos, pos);
+                }
+                else if (el.createTextRange) {
+                    range = el.createTextRange();
+                    range.collapse(false);
+                    range.select();
+                }
+            }
+        }, 0);
+    }
+
+    function getCursorInfo(el) {
+        el = $(el)[0];
+        var offset = 0;
+        var length = 0;
+        if ('selectionStart' in el) {
+            offset = el.selectionStart;
+            length = el.selectionEnd - offset;
+        } else if ('selection' in document) {
+            el.focus();
+            var sel = document.selection.createRange();
+            length = document.selection.createRange().text.length;
+            sel.moveStart('character', -el.value.length);
+            offset = sel.text.length - length;
+        }
+        return { offset: offset, length: length };
+    }
+
+    function killEvent(event) {
+        event.preventDefault();
+        event.stopPropagation();
+    }
+    function killEventImmediately(event) {
+        event.preventDefault();
+        event.stopImmediatePropagation();
+    }
+
+    function measureTextWidth(e) {
+        if (!sizer){
+            var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
+            sizer = $(document.createElement("div")).css({
+                position: "absolute",
+                left: "-10000px",
+                top: "-10000px",
+                display: "none",
+                fontSize: style.fontSize,
+                fontFamily: style.fontFamily,
+                fontStyle: style.fontStyle,
+                fontWeight: style.fontWeight,
+                letterSpacing: style.letterSpacing,
+                textTransform: style.textTransform,
+                whiteSpace: "nowrap"
+            });
+            sizer.attr("class","select2-sizer");
+            $("body").append(sizer);
+        }
+        sizer.text(e.val());
+        return sizer.width();
+    }
+
+    function syncCssClasses(dest, src, adapter) {
+        var classes, replacements = [], adapted;
+
+        classes = dest.attr("class");
+        if (classes) {
+            classes = '' + classes; // for IE which returns object
+            $(classes.split(" ")).each2(function() {
+                if (this.indexOf("select2-") === 0) {
+                    replacements.push(this);
+                }
+            });
+        }
+        classes = src.attr("class");
+        if (classes) {
+            classes = '' + classes; // for IE which returns object
+            $(classes.split(" ")).each2(function() {
+                if (this.indexOf("select2-") !== 0) {
+                    adapted = adapter(this);
+                    if (adapted) {
+                        replacements.push(this);
+                    }
+                }
+            });
+        }
+        dest.attr("class", replacements.join(" "));
+    }
+
+
+    function markMatch(text, term, markup, escapeMarkup) {
+        var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
+            tl=term.length;
+
+        if (match<0) {
+            markup.push(escapeMarkup(text));
+            return;
+        }
+
+        markup.push(escapeMarkup(text.substring(0, match)));
+        markup.push("<span class='select2-match'>");
+        markup.push(escapeMarkup(text.substring(match, match + tl)));
+        markup.push("</span>");
+        markup.push(escapeMarkup(text.substring(match + tl, text.length)));
+    }
+
+    function defaultEscapeMarkup(markup) {
+        var replace_map = {
+            '\\': '&#92;',
+            '&': '&amp;',
+            '<': '&lt;',
+            '>': '&gt;',
+            '"': '&quot;',
+            "'": '&#39;',
+            "/": '&#47;'
+        };
+
+        return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
+            return replace_map[match];
+        });
+    }
+
+    /**
+     * Produces an ajax-based query function
+     *
+     * @param options object containing configuration paramters
+     * @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
+     * @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
+     * @param options.url url for the data
+     * @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
+     * @param options.dataType request data type: ajax, jsonp, other datatatypes supported by jQuery's $.ajax function or the transport function if specified
+     * @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
+     * @param options.results a function(remoteData, pageNumber) that converts data returned form the remote request to the format expected by Select2.
+     *      The expected format is an object containing the following keys:
+     *      results array of objects that will be used as choices
+     *      more (optional) boolean indicating whether there are more results available
+     *      Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
+     */
+    function ajax(options) {
+        var timeout, // current scheduled but not yet executed request
+            handler = null,
+            quietMillis = options.quietMillis || 100,
+            ajaxUrl = options.url,
+            self = this;
+
+        return function (query) {
+            window.clearTimeout(timeout);
+            timeout = window.setTimeout(function () {
+                var data = options.data, // ajax data function
+                    url = ajaxUrl, // ajax url string or function
+                    transport = options.transport || $.fn.select2.ajaxDefaults.transport,
+                    // deprecated - to be removed in 4.0  - use params instead
+                    deprecated = {
+                        type: options.type || 'GET', // set type of request (GET or POST)
+                        cache: options.cache || false,
+                        jsonpCallback: options.jsonpCallback||undefined,
+                        dataType: options.dataType||"json"
+                    },
+                    params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
+
+                data = data ? data.call(self, query.term, query.page, query.context) : null;
+                url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
+
+                if (handler) { handler.abort(); }
+
+                if (options.params) {
+                    if ($.isFunction(options.params)) {
+                        $.extend(params, options.params.call(self));
+                    } else {
+                        $.extend(params, options.params);
+                    }
+                }
+
+                $.extend(params, {
+                    url: url,
+                    dataType: options.dataType,
+                    data: data,
+                    success: function (data) {
+                        // TODO - replace query.page with query so users have access to term, page, etc.
+                        var results = options.results(data, query.page);
+                        query.callback(results);
+                    }
+                });
+                handler = transport.call(self, params);
+            }, quietMillis);
+        };
+    }
+
+    /**
+     * Produces a query function that works with a local array
+     *
+     * @param options object containing configuration parameters. The options parameter can either be an array or an
+     * object.
+     *
+     * If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
+     *
+     * If the object form is used ti is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
+     * an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
+     * key can either be a String in which case it is expected that each element in the 'data' array has a key with the
+     * value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
+     * the text.
+     */
+    function local(options) {
+        var data = options, // data elements
+            dataText,
+            tmp,
+            text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
+
+         if ($.isArray(data)) {
+            tmp = data;
+            data = { results: tmp };
+        }
+
+         if ($.isFunction(data) === false) {
+            tmp = data;
+            data = function() { return tmp; };
+        }
+
+        var dataItem = data();
+        if (dataItem.text) {
+            text = dataItem.text;
+            // if text is not a function we assume it to be a key name
+            if (!$.isFunction(text)) {
+                dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
+                text = function (item) { return item[dataText]; };
+            }
+        }
+
+        return function (query) {
+            var t = query.term, filtered = { results: [] }, process;
+            if (t === "") {
+                query.callback(data());
+                return;
+            }
+
+            process = function(datum, collection) {
+                var group, attr;
+                datum = datum[0];
+                if (datum.children) {
+                    group = {};
+                    for (attr in datum) {
+                        if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
+                    }
+                    group.children=[];
+                    $(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
+                    if (group.children.length || query.matcher(t, text(group), datum)) {
+                        collection.push(group);
+                    }
+                } else {
+                    if (query.matcher(t, text(datum), datum)) {
+                        collection.push(datum);
+                    }
+                }
+            };
+
+            $(data().results).each2(function(i, datum) { process(datum, filtered.results); });
+            query.callback(filtered);
+        };
+    }
+
+    // TODO javadoc
+    function tags(data) {
+        var isFunc = $.isFunction(data);
+        return function (query) {
+            var t = query.term, filtered = {results: []};
+            $(isFunc ? data() : data).each(function () {
+                var isObject = this.text !== undefined,
+                    text = isObject ? this.text : this;
+                if (t === "" || query.matcher(t, text)) {
+                    filtered.results.push(isObject ? this : {id: this, text: this});
+                }
+            });
+            query.callback(filtered);
+        };
+    }
+
+    /**
+     * Checks if the formatter function should be used.
+     *
+     * Throws an error if it is not a function. Returns true if it should be used,
+     * false if no formatting should be performed.
+     *
+     * @param formatter
+     */
+    function checkFormatter(formatter, formatterName) {
+        if ($.isFunction(formatter)) return true;
+        if (!formatter) return false;
+        throw new Error(formatterName +" must be a function or a falsy value");
+    }
+
+    function evaluate(val) {
+        return $.isFunction(val) ? val() : val;
+    }
+
+    function countResults(results) {
+        var count = 0;
+        $.each(results, function(i, item) {
+            if (item.children) {
+                count += countResults(item.children);
+            } else {
+                count++;
+            }
+        });
+        return count;
+    }
+
+    /**
+     * Default tokenizer. This function uses breaks the input on substring match of any string from the
+     * opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
+     * two options have to be defined in order for the tokenizer to work.
+     *
+     * @param input text user has typed so far or pasted into the search field
+     * @param selection currently selected choices
+     * @param selectCallback function(choice) callback tho add the choice to selection
+     * @param opts select2's opts
+     * @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
+     */
+    function defaultTokenizer(input, selection, selectCallback, opts) {
+        var original = input, // store the original so we can compare and know if we need to tell the search to update its text
+            dupe = false, // check for whether a token we extracted represents a duplicate selected choice
+            token, // token
+            index, // position at which the separator was found
+            i, l, // looping variables
+            separator; // the matched separator
+
+        if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
+
+        while (true) {
+            index = -1;
+
+            for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
+                separator = opts.tokenSeparators[i];
+                index = input.indexOf(separator);
+                if (index >= 0) break;
+            }
+
+            if (index < 0) break; // did not find any token separator in the input string, bail
+
+            token = input.substring(0, index);
+            input = input.substring(index + separator.length);
+
+            if (token.length > 0) {
+                token = opts.createSearchChoice.call(this, token, selection);
+                if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
+                    dupe = false;
+                    for (i = 0, l = selection.length; i < l; i++) {
+                        if (equal(opts.id(token), opts.id(selection[i]))) {
+                            dupe = true; break;
+                        }
+                    }
+
+                    if (!dupe) selectCallback(token);
+                }
+            }
+        }
+
+        if (original!==input) return input;
+    }
+
+    /**
+     * Creates a new class
+     *
+     * @param superClass
+     * @param methods
+     */
+    function clazz(SuperClass, methods) {
+        var constructor = function () {};
+        constructor.prototype = new SuperClass;
+        constructor.prototype.constructor = constructor;
+        constructor.prototype.parent = SuperClass.prototype;
+        constructor.prototype = $.extend(constructor.prototype, methods);
+        return constructor;
+    }
+
+    AbstractSelect2 = clazz(Object, {
+
+        // abstract
+        bind: function (func) {
+            var self = this;
+            return function () {
+                func.apply(self, arguments);
+            };
+        },
+
+        // abstract
+        init: function (opts) {
+            var results, search, resultsSelector = ".select2-results", disabled, readonly;
+
+            // prepare options
+            this.opts = opts = this.prepareOpts(opts);
+
+            this.id=opts.id;
+
+            // destroy if called on an existing component
+            if (opts.element.data("select2") !== undefined &&
+                opts.element.data("select2") !== null) {
+                opts.element.data("select2").destroy();
+            }
+
+            this.container = this.createContainer();
+
+            this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
+            this.containerSelector="#"+this.containerId.replace(/([;&,\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
+            this.container.attr("id", this.containerId);
+
+            // cache the body so future lookups are cheap
+            this.body = thunk(function() { return opts.element.closest("body"); });
+
+            syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
+
+            this.container.attr("style", opts.element.attr("style"));
+            this.container.css(evaluate(opts.containerCss));
+            this.container.addClass(evaluate(opts.containerCssClass));
+
+            this.elementTabIndex = this.opts.element.attr("tabindex");
+
+            // swap container for the element
+            this.opts.element
+                .data("select2", this)
+                .attr("tabindex", "-1")
+                .before(this.container)
+                .on("click.select2", killEvent); // do not leak click events
+
+            this.container.data("select2", this);
+
+            this.dropdown = this.container.find(".select2-drop");
+
+            syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
+
+            this.dropdown.addClass(evaluate(opts.dropdownCssClass));
+            this.dropdown.data("select2", this);
+            this.dropdown.on("click", killEvent);
+
+            this.results = results = this.container.find(resultsSelector);
+            this.search = search = this.container.find("input.select2-input");
+
+            this.queryCount = 0;
+            this.resultsPage = 0;
+            this.context = null;
+
+            // initialize the container
+            this.initContainer();
+
+            this.container.on("click", killEvent);
+
+            installFilteredMouseMove(this.results);
+            this.dropdown.on("mousemove-filtered touchstart touchmove touchend", resultsSelector, this.bind(this.highlightUnderEvent));
+
+            installDebouncedScroll(80, this.results);
+            this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
+
+            // do not propagate change event from the search field out of the component
+            $(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
+            $(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
+
+            // if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
+            if ($.fn.mousewheel) {
+                results.mousewheel(function (e, delta, deltaX, deltaY) {
+                    var top = results.scrollTop(), height;
+                    if (deltaY > 0 && top - deltaY <= 0) {
+                        results.scrollTop(0);
+                        killEvent(e);
+                    } else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
+                        results.scrollTop(results.get(0).scrollHeight - results.height());
+                        killEvent(e);
+                    }
+                });
+            }
+
+            installKeyUpChangeEvent(search);
+            search.on("keyup-change input paste", this.bind(this.updateResults));
+            search.on("focus", function () { search.addClass("select2-focused"); });
+            search.on("blur", function () { search.removeClass("select2-focused");});
+
+            this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
+                if ($(e.target).closest(".select2-result-selectable").length > 0) {
+                    this.highlightUnderEvent(e);
+                    this.selectHighlighted(e);
+                }
+            }));
+
+            // trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
+            // for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
+            // dom it will trigger the popup close, which is not what we want
+            this.dropdown.on("click mouseup mousedown", function (e) { e.stopPropagation(); });
+
+            if ($.isFunction(this.opts.initSelection)) {
+                // initialize selection based on the current value of the source element
+                this.initSelection();
+
+                // if the user has provided a function that can set selection based on the value of the source element
+                // we monitor the change event on the element and trigger it, allowing for two way synchronization
+                this.monitorSource();
+            }
+
+            if (opts.maximumInputLength !== null) {
+                this.search.attr("maxlength", opts.maximumInputLength);
+            }
+
+            var disabled = opts.element.prop("disabled");
+            if (disabled === undefined) disabled = false;
+            this.enable(!disabled);
+
+            var readonly = opts.element.prop("readonly");
+            if (readonly === undefined) readonly = false;
+            this.readonly(readonly);
+
+            // Calculate size of scrollbar
+            scrollBarDimensions = scrollBarDimensions || measureScrollbar();
+
+            this.autofocus = opts.element.prop("autofocus");
+            opts.element.prop("autofocus", false);
+            if (this.autofocus) this.focus();
+
+            this.nextSearchTerm = undefined;
+        },
+
+        // abstract
+        destroy: function () {
+            var element=this.opts.element, select2 = element.data("select2");
+
+            this.close();
+
+            if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
+
+            if (select2 !== undefined) {
+                select2.container.remove();
+                select2.dropdown.remove();
+                element
+                    .removeClass("select2-offscreen")
+                    .removeData("select2")
+                    .off(".select2")
+                    .prop("autofocus", this.autofocus || false);
+                if (this.elementTabIndex) {
+                    element.attr({tabindex: this.elementTabIndex});
+                } else {
+                    element.removeAttr("tabindex");
+                }
+                element.show();
+            }
+        },
+
+        // abstract
+        optionToData: function(element) {
+            if (element.is("option")) {
+                return {
+                    id:element.prop("value"),
+                    text:element.text(),
+                    element: element.get(),
+                    css: element.attr("class"),
+                    disabled: element.prop("disabled"),
+                    locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
+                };
+            } else if (element.is("optgroup")) {
+                return {
+                    text:element.attr("label"),
+                    children:[],
+                    element: element.get(),
+                    css: element.attr("class")
+                };
+            }
+        },
+
+        // abstract
+        prepareOpts: function (opts) {
+            var element, select, idKey, ajaxUrl, self = this;
+
+            element = opts.element;
+
+            if (element.get(0).tagName.toLowerCase() === "select") {
+                this.select = select = opts.element;
+            }
+
+            if (select) {
+                // these options are not allowed when attached to a select because they are picked up off the element itself
+                $.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
+                    if (this in opts) {
+                        throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
+                    }
+                });
+            }
+
+            opts = $.extend({}, {
+                populateResults: function(container, results, query) {
+                    var populate,  data, result, children, id=this.opts.id;
+
+                    populate=function(results, container, depth) {
+
+                        var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
+
+                        results = opts.sortResults(results, container, query);
+
+                        for (i = 0, l = results.length; i < l; i = i + 1) {
+
+                            result=results[i];
+
+                            disabled = (result.disabled === true);
+                            selectable = (!disabled) && (id(result) !== undefined);
+
+                            compound=result.children && result.children.length > 0;
+
+                            node=$("<li></li>");
+                            node.addClass("select2-results-dept-"+depth);
+                            node.addClass("select2-result");
+                            node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
+                            if (disabled) { node.addClass("select2-disabled"); }
+                            if (compound) { node.addClass("select2-result-with-children"); }
+                            node.addClass(self.opts.formatResultCssClass(result));
+
+                            label=$(document.createElement("div"));
+                            label.addClass("select2-result-label");
+
+                            formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
+                            if (formatted!==undefined) {
+                                label.html(formatted);
+                            }
+
+                            node.append(label);
+
+                            if (compound) {
+
+                                innerContainer=$("<ul></ul>");
+                                innerContainer.addClass("select2-result-sub");
+                                populate(result.children, innerContainer, depth+1);
+                                node.append(innerContainer);
+                            }
+
+                            node.data("select2-data", result);
+                            container.append(node);
+                        }
+                    };
+
+                    populate(results, container, 0);
+                }
+            }, $.fn.select2.defaults, opts);
+
+            if (typeof(opts.id) !== "function") {
+                idKey = opts.id;
+                opts.id = function (e) { return e[idKey]; };
+            }
+
+            if ($.isArray(opts.element.data("select2Tags"))) {
+                if ("tags" in opts) {
+                    throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
+                }
+                opts.tags=opts.element.data("select2Tags");
+            }
+
+            if (select) {
+                opts.query = this.bind(function (query) {
+                    var data = { results: [], more: false },
+                        term = query.term,
+                        children, placeholderOption, process;
+
+                    process=function(element, collection) {
+                        var group;
+                        if (element.is("option")) {
+                            if (query.matcher(term, element.text(), element)) {
+                                collection.push(self.optionToData(element));
+                            }
+                        } else if (element.is("optgroup")) {
+                            group=self.optionToData(element);
+                            element.children().each2(function(i, elm) { process(elm, group.children); });
+                            if (group.children.length>0) {
+                                collection.push(group);
+                            }
+                        }
+                    };
+
+                    children=element.children();
+
+                    // ignore the placeholder option if there is one
+                    if (this.getPlaceholder() !== undefined && children.length > 0) {
+                        placeholderOption = this.getPlaceholderOption();
+                        if (placeholderOption) {
+                            children=children.not(placeholderOption);
+                        }
+                    }
+
+                    children.each2(function(i, elm) { process(elm, data.results); });
+
+                    query.callback(data);
+                });
+                // this is needed because inside val() we construct choices from options and there id is hardcoded
+                opts.id=function(e) { return e.id; };
+                opts.formatResultCssClass = function(data) { return data.css; };
+            } else {
+                if (!("query" in opts)) {
+
+                    if ("ajax" in opts) {
+                        ajaxUrl = opts.element.data("ajax-url");
+                        if (ajaxUrl && ajaxUrl.length > 0) {
+                            opts.ajax.url = ajaxUrl;
+                        }
+                        opts.query = ajax.call(opts.element, opts.ajax);
+                    } else if ("data" in opts) {
+                        opts.query = local(opts.data);
+                    } else if ("tags" in opts) {
+                        opts.query = tags(opts.tags);
+                        if (opts.createSearchChoice === undefined) {
+                            opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
+                        }
+                        if (opts.initSelection === undefined) {
+                            opts.initSelection = function (element, callback) {
+                                var data = [];
+                                $(splitVal(element.val(), opts.separator)).each(function () {
+                                    var obj = { id: this, text: this },
+                                        tags = opts.tags;
+                                    if ($.isFunction(tags)) tags=tags();
+                                    $(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
+                                    data.push(obj);
+                                });
+
+                                callback(data);
+                            };
+                        }
+                    }
+                }
+            }
+            if (typeof(opts.query) !== "function") {
+                throw "query function not defined for Select2 " + opts.element.attr("id");
+            }
+
+            return opts;
+        },
+
+        /**
+         * Monitor the original element for changes and update select2 accordingly
+         */
+        // abstract
+        monitorSource: function () {
+            var el = this.opts.element, sync;
+
+            el.on("change.select2", this.bind(function (e) {
+                if (this.opts.element.data("select2-change-triggered") !== true) {
+                    this.initSelection();
+                }
+            }));
+
+            sync = this.bind(function () {
+
+                var enabled, readonly, self = this;
+
+                // sync enabled state
+                var disabled = el.prop("disabled");
+                if (disabled === undefined) disabled = false;
+                this.enable(!disabled);
+
+                var readonly = el.prop("readonly");
+                if (readonly === undefined) readonly = false;
+                this.readonly(readonly);
+
+                syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
+                this.container.addClass(evaluate(this.opts.containerCssClass));
+
+                syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
+                this.dropdown.addClass(evaluate(this.opts.dropdownCssClass));
+
+            });
+
+            // mozilla and IE
+            el.on("propertychange.select2 DOMAttrModified.select2", sync);
+
+
+            // hold onto a reference of the callback to work around a chromium bug
+            if (this.mutationCallback === undefined) {
+                this.mutationCallback = function (mutations) {
+                    mutations.forEach(sync);
+                }
+            }
+
+            // safari and chrome
+            if (typeof WebKitMutationObserver !== "undefined") {
+                if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
+                this.propertyObserver = new WebKitMutationObserver(this.mutationCallback);
+                this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
+            }
+        },
+
+        // abstract
+        triggerSelect: function(data) {
+            var evt = $.Event("select2-selecting", { val: this.id(data), object: data });
+            this.opts.element.trigger(evt);
+            return !evt.isDefaultPrevented();
+        },
+
+        /**
+         * Triggers the change event on the source element
+         */
+        // abstract
+        triggerChange: function (details) {
+
+            details = details || {};
+            details= $.extend({}, details, { type: "change", val: this.val() });
+            // prevents recursive triggering
+            this.opts.element.data("select2-change-triggered", true);
+            this.opts.element.trigger(details);
+            this.opts.element.data("select2-change-triggered", false);
+
+            // some validation frameworks ignore the change event and listen instead to keyup, click for selects
+            // so here we trigger the click event manually
+            this.opts.element.click();
+
+            // ValidationEngine ignorea the change event and listens instead to blur
+            // so here we trigger the blur event manually if so desired
+            if (this.opts.blurOnChange)
+                this.opts.element.blur();
+        },
+
+        //abstract
+        isInterfaceEnabled: function()
+        {
+            return this.enabledInterface === true;
+        },
+
+        // abstract
+        enableInterface: function() {
+            var enabled = this._enabled && !this._readonly,
+                disabled = !enabled;
+
+            if (enabled === this.enabledInterface) return false;
+
+            this.container.toggleClass("select2-container-disabled", disabled);
+            this.close();
+            this.enabledInterface = enabled;
+
+            return true;
+        },
+
+        // abstract
+        enable: function(enabled) {
+            if (enabled === undefined) enabled = true;
+            if (this._enabled === enabled) return;
+            this._enabled = enabled;
+
+            this.opts.element.prop("disabled", !enabled);
+            this.enableInterface();
+        },
+
+        // abstract
+        disable: function() {
+            this.enable(false);
+        },
+
+        // abstract
+        readonly: function(enabled) {
+            if (enabled === undefined) enabled = false;
+            if (this._readonly === enabled) return false;
+            this._readonly = enabled;
+
+            this.opts.element.prop("readonly", enabled);
+            this.enableInterface();
+            return true;
+        },
+
+        // abstract
+        opened: function () {
+            return this.container.hasClass("select2-dropdown-open");
+        },
+
+        // abstract
+        positionDropdown: function() {
+            var $dropdown = this.dropdown,
+                offset = this.container.offset(),
+                height = this.container.outerHeight(false),
+                width = this.container.outerWidth(false),
+                dropHeight = $dropdown.outerHeight(false),
+                viewPortRight = $(window).scrollLeft() + $(window).width(),
+                viewportBottom = $(window).scrollTop() + $(window).height(),
+                dropTop = offset.top + height,
+                dropLeft = offset.left,
+                enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
+                enoughRoomAbove = (offset.top - dropHeight) >= this.body().scrollTop(),
+                dropWidth = $dropdown.outerWidth(false),
+                enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight,
+                aboveNow = $dropdown.hasClass("select2-drop-above"),
+                bodyOffset,
+                above,
+                css,
+                resultsListNode;
+
+            if (this.opts.dropdownAutoWidth) {
+                resultsListNode = $('.select2-results', $dropdown)[0];
+                $dropdown.addClass('select2-drop-auto-width');
+                $dropdown.css('width', '');
+                // Add scrollbar width to dropdown if vertical scrollbar is present
+                dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
+                dropWidth > width ? width = dropWidth : dropWidth = width;
+                enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight;
+            }
+            else {
+                this.container.removeClass('select2-drop-auto-width');
+            }
+
+            //console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
+            //console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body().scrollTop(), "enough?", enoughRoomAbove);
+
+            // fix positioning when body has an offset and is not position: static
+            if (this.body().css('position') !== 'static') {
+                bodyOffset = this.body().offset();
+                dropTop -= bodyOffset.top;
+                dropLeft -= bodyOffset.left;
+            }
+
+            // always prefer the current above/below alignment, unless there is not enough room
+            if (aboveNow) {
+                above = true;
+                if (!enoughRoomAbove && enoughRoomBelow) above = false;
+            } else {
+                above = false;
+                if (!enoughRoomBelow && enoughRoomAbove) above = true;
+            }
+
+            if (!enoughRoomOnRight) {
+               dropLeft = offset.left + width - dropWidth;
+            }
+
+            if (above) {
+                dropTop = offset.top - dropHeight;
+                this.container.addClass("select2-drop-above");
+                $dropdown.addClass("select2-drop-above");
+            }
+            else {
+                this.container.removeClass("select2-drop-above");
+                $dropdown.removeClass("select2-drop-above");
+            }
+
+            css = $.extend({
+                top: dropTop,
+                left: dropLeft,
+                width: width
+            }, evaluate(this.opts.dropdownCss));
+
+            $dropdown.css(css);
+        },
+
+        // abstract
+        shouldOpen: function() {
+            var event;
+
+            if (this.opened()) return false;
+
+            if (this._enabled === false || this._readonly === true) return false;
+
+            event = $.Event("select2-opening");
+            this.opts.element.trigger(event);
+            return !event.isDefaultPrevented();
+        },
+
+        // abstract
+        clearDropdownAlignmentPreference: function() {
+            // clear the classes used to figure out the preference of where the dropdown should be opened
+            this.container.removeClass("select2-drop-above");
+            this.dropdown.removeClass("select2-drop-above");
+        },
+
+        /**
+         * Opens the dropdown
+         *
+         * @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
+         * the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
+         */
+        // abstract
+        open: function () {
+
+            if (!this.shouldOpen()) return false;
+
+            this.opening();
+
+            return true;
+        },
+
+        /**
+         * Performs the opening of the dropdown
+         */
+        // abstract
+        opening: function() {
+            var cid = this.containerId,
+                scroll = "scroll." + cid,
+                resize = "resize."+cid,
+                orient = "orientationchange."+cid,
+                mask, maskCss;
+
+            this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
+
+            this.clearDropdownAlignmentPreference();
+
+            if(this.dropdown[0] !== this.body().children().last()[0]) {
+                this.dropdown.detach().appendTo(this.body());
+            }
+
+            // create the dropdown mask if doesnt already exist
+            mask = $("#select2-drop-mask");
+            if (mask.length == 0) {
+                mask = $(document.createElement("div"));
+                mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
+                mask.hide();
+                mask.appendTo(this.body());
+                mask.on("mousedown touchstart click", function (e) {
+                    var dropdown = $("#select2-drop"), self;
+                    if (dropdown.length > 0) {
+                        self=dropdown.data("select2");
+                        if (self.opts.selectOnBlur) {
+                            self.selectHighlighted({noFocus: true});
+                        }
+                        self.close({focus:false});
+                        e.preventDefault();
+                        e.stopPropagation();
+                    }
+                });
+            }
+
+            // ensure the mask is always right before the dropdown
+            if (this.dropdown.prev()[0] !== mask[0]) {
+                this.dropdown.before(mask);
+            }
+
+            // move the global id to the correct dropdown
+            $("#select2-drop").removeAttr("id");
+            this.dropdown.attr("id", "select2-drop");
+
+            // show the elements
+            mask.show();
+
+            this.positionDropdown();
+            this.dropdown.show();
+            this.positionDropdown();
+
+            this.dropdown.addClass("select2-drop-active");
+
+            // attach listeners to events that can change the position of the container and thus require
+            // the position of the dropdown to be updated as well so it does not come unglued from the container
+            var that = this;
+            this.container.parents().add(window).each(function () {
+                $(this).on(resize+" "+scroll+" "+orient, function (e) {
+                    that.positionDropdown();
+                });
+            });
+
+
+        },
+
+        // abstract
+        close: function () {
+            if (!this.opened()) return;
+
+            var cid = this.containerId,
+                scroll = "scroll." + cid,
+                resize = "resize."+cid,
+                orient = "orientationchange."+cid;
+
+            // unbind event listeners
+            this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
+
+            this.clearDropdownAlignmentPreference();
+
+            $("#select2-drop-mask").hide();
+            this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
+            this.dropdown.hide();
+            this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
+            this.results.empty();
+
+
+            this.clearSearch();
+            this.search.removeClass("select2-active");
+            this.opts.element.trigger($.Event("select2-close"));
+        },
+
+        /**
+         * Opens control, sets input value, and updates results.
+         */
+        // abstract
+        externalSearch: function (term) {
+            this.open();
+            this.search.val(term);
+            this.updateResults(false);
+        },
+
+        // abstract
+        clearSearch: function () {
+
+        },
+
+        //abstract
+        getMaximumSelectionSize: function() {
+            return evaluate(this.opts.maximumSelectionSize);
+        },
+
+        // abstract
+        ensureHighlightVisible: function () {
+            var results = this.results, children, index, child, hb, rb, y, more;
+
+            index = this.highlight();
+
+            if (index < 0) return;
+
+            if (index == 0) {
+
+                // if the first element is highlighted scroll all the way to the top,
+                // that way any unselectable headers above it will also be scrolled
+                // into view
+
+                results.scrollTop(0);
+                return;
+            }
+
+            children = this.findHighlightableChoices().find('.select2-result-label');
+
+            child = $(children[index]);
+
+            hb = child.offset().top + child.outerHeight(true);
+
+            // if this is the last child lets also make sure select2-more-results is visible
+            if (index === children.length - 1) {
+                more = results.find("li.select2-more-results");
+                if (more.length > 0) {
+                    hb = more.offset().top + more.outerHeight(true);
+                }
+            }
+
+            rb = results.offset().top + results.outerHeight(true);
+            if (hb > rb) {
+                results.scrollTop(results.scrollTop() + (hb - rb));
+            }
+            y = child.offset().top - results.offset().top;
+
+            // make sure the top of the element is visible
+            if (y < 0 && child.css('display') != 'none' ) {
+                results.scrollTop(results.scrollTop() + y); // y is negative
+            }
+        },
+
+        // abstract
+        findHighlightableChoices: function() {
+            return this.results.find(".select2-result-selectable:not(.select2-disabled)");
+        },
+
+        // abstract
+        moveHighlight: function (delta) {
+            var choices = this.findHighlightableChoices(),
+                index = this.highlight();
+
+            while (index > -1 && index < choices.length) {
+                index += delta;
+                var choice = $(choices[index]);
+                if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
+                    this.highlight(index);
+                    break;
+                }
+            }
+        },
+
+        // abstract
+        highlight: function (index) {
+            var choices = this.findHighlightableChoices(),
+                choice,
+                data;
+
+            if (arguments.length === 0) {
+                return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
+            }
+
+            if (index >= choices.length) index = choices.length - 1;
+            if (index < 0) index = 0;
+
+            this.removeHighlight();
+
+            choice = $(choices[index]);
+            choice.addClass("select2-highlighted");
+
+            this.ensureHighlightVisible();
+
+            data = choice.data("select2-data");
+            if (data) {
+                this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
+            }
+        },
+
+        removeHighlight: function() {
+            this.results.find(".select2-highlighted").removeClass("select2-highlighted");
+        },
+
+        // abstract
+        countSelectableResults: function() {
+            return this.findHighlightableChoices().length;
+        },
+
+        // abstract
+        highlightUnderEvent: function (event) {
+            var el = $(event.target).closest(".select2-result-selectable");
+            if (el.length > 0 && !el.is(".select2-highlighted")) {
+                var choices = this.findHighlightableChoices();
+                this.highlight(choices.index(el));
+            } else if (el.length == 0) {
+                // if we are over an unselectable item remove all highlights
+                this.removeHighlight();
+            }
+        },
+
+        // abstract
+        loadMoreIfNeeded: function () {
+            var results = this.results,
+                more = results.find("li.select2-more-results"),
+                below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
+                offset = -1, // index of first element without data
+                page = this.resultsPage + 1,
+                self=this,
+                term=this.search.val(),
+                context=this.context;
+
+            if (more.length === 0) return;
+            below = more.offset().top - results.offset().top - results.height();
+
+            if (below <= this.opts.loadMorePadding) {
+                more.addClass("select2-active");
+                this.opts.query({
+                        element: this.opts.element,
+                        term: term,
+                        page: page,
+                        context: context,
+                        matcher: this.opts.matcher,
+                        callback: this.bind(function (data) {
+
+                    // ignore a response if the select2 has been closed before it was received
+                    if (!self.opened()) return;
+
+
+                    self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
+                    self.postprocessResults(data, false, false);
+
+                    if (data.more===true) {
+                        more.detach().appendTo(results).text(self.opts.formatLoadMore(page+1));
+                        window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
+                    } else {
+                        more.remove();
+                    }
+                    self.positionDropdown();
+                    self.resultsPage = page;
+                    self.context = data.context;
+                    this.opts.element.trigger({ type: "select2-loaded", items: data });
+                })});
+            }
+        },
+
+        /**
+         * Default tokenizer function which does nothing
+         */
+        tokenize: function() {
+
+        },
+
+        /**
+         * @param initial whether or not this is the call to this method right after the dropdown has been opened
+         */
+        // abstract
+        updateResults: function (initial) {
+            var search = this.search,
+                results = this.results,
+                opts = this.opts,
+                data,
+                self = this,
+                input,
+                term = search.val(),
+                lastTerm = $.data(this.container, "select2-last-term"),
+                // sequence number used to drop out-of-order responses
+                queryNumber;
+
+            // prevent duplicate queries against the same term
+            if (initial !== true && lastTerm && equal(term, lastTerm)) return;
+
+            $.data(this.container, "select2-last-term", term);
+
+            // if the search is currently hidden we do not alter the results
+            if (initial !== true && (this.showSearchInput === false || !this.opened())) {
+                return;
+            }
+
+            function postRender() {
+                search.removeClass("select2-active");
+                self.positionDropdown();
+            }
+
+            function render(html) {
+                results.html(html);
+                postRender();
+            }
+
+            queryNumber = ++this.queryCount;
+
+            var maxSelSize = this.getMaximumSelectionSize();
+            if (maxSelSize >=1) {
+                data = this.data();
+                if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
+                    render("<li class='select2-selection-limit'>" + opts.formatSelectionTooBig(maxSelSize) + "</li>");
+                    return;
+                }
+            }
+
+            if (search.val().length < opts.minimumInputLength) {
+                if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
+                    render("<li class='select2-no-results'>" + opts.formatInputTooShort(search.val(), opts.minimumInputLength) + "</li>");
+                } else {
+                    render("");
+                }
+                if (initial && this.showSearch) this.showSearch(true);
+                return;
+            }
+
+            if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
+                if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
+                    render("<li class='select2-no-results'>" + opts.formatInputTooLong(search.val(), opts.maximumInputLength) + "</li>");
+                } else {
+                    render("");
+                }
+                return;
+            }
+
+            if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
+                render("<li class='select2-searching'>" + opts.formatSearching() + "</li>");
+            }
+
+            search.addClass("select2-active");
+
+            this.removeHighlight();
+
+            // give the tokenizer a chance to pre-process the input
+            input = this.tokenize();
+            if (input != undefined && input != null) {
+                search.val(input);
+            }
+
+            this.resultsPage = 1;
+
+            opts.query({
+                element: opts.element,
+                    term: search.val(),
+                    page: this.resultsPage,
+                    context: null,
+                    matcher: opts.matcher,
+                    callback: this.bind(function (data) {
+                var def; // default choice
+
+                // ignore old responses
+                if (queryNumber != this.queryCount) {
+                  return;
+                }
+
+                // ignore a response if the select2 has been closed before it was received
+                if (!this.opened()) {
+                    this.search.removeClass("select2-active");
+                    return;
+                }
+
+                // save context, if any
+                this.context = (data.context===undefined) ? null : data.context;
+                // create a default choice and prepend it to the list
+                if (this.opts.createSearchChoice && search.val() !== "") {
+                    def = this.opts.createSearchChoice.call(self, search.val(), data.results);
+                    if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
+                        if ($(data.results).filter(
+                            function () {
+                                return equal(self.id(this), self.id(def));
+                            }).length === 0) {
+                            data.results.unshift(def);
+                        }
+                    }
+                }
+
+                if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
+                    render("<li class='select2-no-results'>" + opts.formatNoMatches(search.val()) + "</li>");
+                    return;
+                }
+
+                results.empty();
+                self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
+
+                if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
+                    results.append("<li class='select2-more-results'>" + self.opts.escapeMarkup(opts.formatLoadMore(this.resultsPage)) + "</li>");
+                    window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
+                }
+
+                this.postprocessResults(data, initial);
+
+                postRender();
+
+                this.opts.element.trigger({ type: "select2-loaded", items: data });
+            })});
+        },
+
+        // abstract
+        cancel: function () {
+            this.close();
+        },
+
+        // abstract
+        blur: function () {
+            // if selectOnBlur == true, select the currently highlighted option
+            if (this.opts.selectOnBlur)
+                this.selectHighlighted({noFocus: true});
+
+            this.close();
+            this.container.removeClass("select2-container-active");
+            // synonymous to .is(':focus'), which is available in jquery >= 1.6
+            if (this.search[0] === document.activeElement) { this.search.blur(); }
+            this.clearSearch();
+            this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
+        },
+
+        // abstract
+        focusSearch: function () {
+            focus(this.search);
+        },
+
+        // abstract
+        selectHighlighted: function (options) {
+            var index=this.highlight(),
+                highlighted=this.results.find(".select2-highlighted"),
+                data = highlighted.closest('.select2-result').data("select2-data");
+
+            if (data) {
+                this.highlight(index);
+                this.onSelect(data, options);
+            } else if (options && options.noFocus) {
+                this.close();
+            }
+        },
+
+        // abstract
+        getPlaceholder: function () {
+            var placeholderOption;
+            return this.opts.element.attr("placeholder") ||
+                this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
+                this.opts.element.data("placeholder") ||
+                this.opts.placeholder ||
+                ((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
+        },
+
+        // abstract
+        getPlaceholderOption: function() {
+            if (this.select) {
+                var firstOption = this.select.children().first();
+                if (this.opts.placeholderOption !== undefined ) {
+                    //Determine the placeholder option based on the specified placeholderOption setting
+                    return (this.opts.placeholderOption === "first" && firstOption) ||
+                           (typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
+                } else if (firstOption.text() === "" && firstOption.val() === "") {
+                    //No explicit placeholder option specified, use the first if it's blank
+                    return firstOption;
+                }
+            }
+        },
+
+        /**
+         * Get the desired width for the container element.  This is
+         * derived first from option `width` passed to select2, then
+         * the inline 'style' on the original element, and finally
+         * falls back to the jQuery calculated element width.
+         */
+        // abstract
+        initContainerWidth: function () {
+            function resolveContainerWidth() {
+                var style, attrs, matches, i, l;
+
+                if (this.opts.width === "off") {
+                    return null;
+                } else if (this.opts.width === "element"){
+                    return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
+                } else if (this.opts.width === "copy" || this.opts.width === "resolve") {
+                    // check if there is inline style on the element that contains width
+                    style = this.opts.element.attr('style');
+                    if (style !== undefined) {
+                        attrs = style.split(';');
+                        for (i = 0, l = attrs.length; i < l; i = i + 1) {
+                            matches = attrs[i].replace(/\s/g, '')
+                                .match(/[^-]width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
+                            if (matches !== null && matches.length >= 1)
+                                return matches[1];
+                        }
+                    }
+
+                    if (this.opts.width === "resolve") {
+                        // next check if css('width') can resolve a width that is percent based, this is sometimes possible
+                        // when attached to input type=hidden or elements hidden via css
+                        style = this.opts.element.css('width');
+                        if (style.indexOf("%") > 0) return style;
+
+                        // finally, fallback on the calculated width of the element
+                        return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
+                    }
+
+                    return null;
+                } else if ($.isFunction(this.opts.width)) {
+                    return this.opts.width();
+                } else {
+                    return this.opts.width;
+               }
+            };
+
+            var width = resolveContainerWidth.call(this);
+            if (width !== null) {
+                this.container.css("width", width);
+            }
+        }
+    });
+
+    SingleSelect2 = clazz(AbstractSelect2, {
+
+        // single
+
+        createContainer: function () {
+            var container = $(document.createElement("div")).attr({
+                "class": "select2-container"
+            }).html([
+                "<a href='javascript:void(0)' onclick='return false;' class='select2-choice' tabindex='-1'>",
+                "   <span class='select2-chosen'>&nbsp;</span><abbr class='select2-search-choice-close'></abbr>",
+                "   <span class='select2-arrow'><b></b></span>",
+                "</a>",
+                "<input class='select2-focusser select2-offscreen' type='text'/>",
+                "<div class='select2-drop select2-display-none'>",
+                "   <div class='select2-search'>",
+                "       <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'/>",
+                "   </div>",
+                "   <ul class='select2-results'>",
+                "   </ul>",
+                "</div>"].join(""));
+            return container;
+        },
+
+        // single
+        enableInterface: function() {
+            if (this.parent.enableInterface.apply(this, arguments)) {
+                this.focusser.prop("disabled", !this.isInterfaceEnabled());
+            }
+        },
+
+        // single
+        opening: function () {
+            var el, range, len;
+
+            if (this.opts.minimumResultsForSearch >= 0) {
+                this.showSearch(true);
+            }
+
+            this.parent.opening.apply(this, arguments);
+
+            if (this.showSearchInput !== false) {
+                // IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
+                // all other browsers handle this just fine
+
+                this.search.val(this.focusser.val());
+            }
+            this.search.focus();
+            // move the cursor to the end after focussing, otherwise it will be at the beginning and
+            // new text will appear *before* focusser.val()
+            el = this.search.get(0);
+            if (el.createTextRange) {
+                range = el.createTextRange();
+                range.collapse(false);
+                range.select();
+            } else if (el.setSelectionRange) {
+                len = this.search.val().length;
+                el.setSelectionRange(len, len);
+            }
+
+            // initializes search's value with nextSearchTerm (if defined by user)
+            // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
+            if(this.search.val() === "") {
+                if(this.nextSearchTerm != undefined){
+                    this.search.val(this.nextSearchTerm);
+                    this.search.select();
+                }
+            }
+
+            this.focusser.prop("disabled", true).val("");
+            this.updateResults(true);
+            this.opts.element.trigger($.Event("select2-open"));
+        },
+
+        // single
+        close: function (params) {
+            if (!this.opened()) return;
+            this.parent.close.apply(this, arguments);
+
+            params = params || {focus: true};
+            this.focusser.removeAttr("disabled");
+
+            if (params.focus) {
+                this.focusser.focus();
+            }
+        },
+
+        // single
+        focus: function () {
+            if (this.opened()) {
+                this.close();
+            } else {
+                this.focusser.removeAttr("disabled");
+                this.focusser.focus();
+            }
+        },
+
+        // single
+        isFocused: function () {
+            return this.container.hasClass("select2-container-active");
+        },
+
+        // single
+        cancel: function () {
+            this.parent.cancel.apply(this, arguments);
+            this.focusser.removeAttr("disabled");
+            this.focusser.focus();
+        },
+
+        // single
+        destroy: function() {
+            $("label[for='" + this.focusser.attr('id') + "']")
+                .attr('for', this.opts.element.attr("id"));
+            this.parent.destroy.apply(this, arguments);
+        },
+
+        // single
+        initContainer: function () {
+
+            var selection,
+                container = this.container,
+                dropdown = this.dropdown;
+
+            if (this.opts.minimumResultsForSearch < 0) {
+                this.showSearch(false);
+            } else {
+                this.showSearch(true);
+            }
+
+            this.selection = selection = container.find(".select2-choice");
+
+            this.focusser = container.find(".select2-focusser");
+
+            // rewrite labels from original element to focusser
+            this.focusser.attr("id", "s2id_autogen"+nextUid());
+
+            $("label[for='" + this.opts.element.attr("id") + "']")
+                .attr('for', this.focusser.attr('id'));
+
+            this.focusser.attr("tabindex", this.elementTabIndex);
+
+            this.search.on("keydown", this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+
+                if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
+                    // prevent the page from scrolling
+                    killEvent(e);
+                    return;
+                }
+
+                switch (e.which) {
+                    case KEY.UP:
+                    case KEY.DOWN:
+                        this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
+                        killEvent(e);
+                        return;
+                    case KEY.ENTER:
+                        this.selectHighlighted();
+                        killEvent(e);
+                        return;
+                    case KEY.TAB:
+                        this.selectHighlighted({noFocus: true});
+                        return;
+                    case KEY.ESC:
+                        this.cancel(e);
+                        killEvent(e);
+                        return;
+                }
+            }));
+
+            this.search.on("blur", this.bind(function(e) {
+                // a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
+                // without this the search field loses focus which is annoying
+                if (document.activeElement === this.body().get(0)) {
+                    window.setTimeout(this.bind(function() {
+                        this.search.focus();
+                    }), 0);
+                }
+            }));
+
+            this.focusser.on("keydown", this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+
+                if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
+                    return;
+                }
+
+                if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
+                    killEvent(e);
+                    return;
+                }
+
+                if (e.which == KEY.DOWN || e.which == KEY.UP
+                    || (e.which == KEY.ENTER && this.opts.openOnEnter)) {
+
+                    if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
+
+                    this.open();
+                    killEvent(e);
+                    return;
+                }
+
+                if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
+                    if (this.opts.allowClear) {
+                        this.clear();
+                    }
+                    killEvent(e);
+                    return;
+                }
+            }));
+
+
+            installKeyUpChangeEvent(this.focusser);
+            this.focusser.on("keyup-change input", this.bind(function(e) {
+                if (this.opts.minimumResultsForSearch >= 0) {
+                    e.stopPropagation();
+                    if (this.opened()) return;
+                    this.open();
+                }
+            }));
+
+            selection.on("mousedown", "abbr", this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+                this.clear();
+                killEventImmediately(e);
+                this.close();
+                this.selection.focus();
+            }));
+
+            selection.on("mousedown", this.bind(function (e) {
+
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+
+                if (this.opened()) {
+                    this.close();
+                } else if (this.isInterfaceEnabled()) {
+                    this.open();
+                }
+
+                killEvent(e);
+            }));
+
+            dropdown.on("mousedown", this.bind(function() { this.search.focus(); }));
+
+            selection.on("focus", this.bind(function(e) {
+                killEvent(e);
+            }));
+
+            this.focusser.on("focus", this.bind(function(){
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+                this.container.addClass("select2-container-active");
+            })).on("blur", this.bind(function() {
+                if (!this.opened()) {
+                    this.container.removeClass("select2-container-active");
+                    this.opts.element.trigger($.Event("select2-blur"));
+                }
+            }));
+            this.search.on("focus", this.bind(function(){
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+                this.container.addClass("select2-container-active");
+            }));
+
+            this.initContainerWidth();
+            this.opts.element.addClass("select2-offscreen");
+            this.setPlaceholder();
+
+        },
+
+        // single
+        clear: function(triggerChange) {
+            var data=this.selection.data("select2-data");
+            if (data) { // guard against queued quick consecutive clicks
+                var evt = $.Event("select2-clearing");
+                this.opts.element.trigger(evt);
+                if (evt.isDefaultPrevented()) {
+                    return;
+                }
+                var placeholderOption = this.getPlaceholderOption();
+                this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
+                this.selection.find(".select2-chosen").empty();
+                this.selection.removeData("select2-data");
+                this.setPlaceholder();
+
+                if (triggerChange !== false){
+                    this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
+                    this.triggerChange({removed:data});
+                }
+            }
+        },
+
+        /**
+         * Sets selection based on source element's value
+         */
+        // single
+        initSelection: function () {
+            var selected;
+            if (this.isPlaceholderOptionSelected()) {
+                this.updateSelection(null);
+                this.close();
+                this.setPlaceholder();
+            } else {
+                var self = this;
+                this.opts.initSelection.call(null, this.opts.element, function(selected){
+                    if (selected !== undefined && selected !== null) {
+                        self.updateSelection(selected);
+                        self.close();
+                        self.setPlaceholder();
+                    }
+                });
+            }
+        },
+
+        isPlaceholderOptionSelected: function() {
+            var placeholderOption;
+            if (!this.getPlaceholder()) return false; // no placeholder specified so no option should be considered
+            return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.is(':selected'))
+                || (this.opts.element.val() === "")
+                || (this.opts.element.val() === undefined)
+                || (this.opts.element.val() === null);
+        },
+
+        // single
+        prepareOpts: function () {
+            var opts = this.parent.prepareOpts.apply(this, arguments),
+                self=this;
+
+            if (opts.element.get(0).tagName.toLowerCase() === "select") {
+                // install the selection initializer
+                opts.initSelection = function (element, callback) {
+                    var selected = element.find(":selected");
+                    // a single select box always has a value, no need to null check 'selected'
+                    callback(self.optionToData(selected));
+                };
+            } else if ("data" in opts) {
+                // install default initSelection when applied to hidden input and data is local
+                opts.initSelection = opts.initSelection || function (element, callback) {
+                    var id = element.val();
+                    //search in data by id, storing the actual matching item
+                    var match = null;
+                    opts.query({
+                        matcher: function(term, text, el){
+                            var is_match = equal(id, opts.id(el));
+                            if (is_match) {
+                                match = el;
+                            }
+                            return is_match;
+                        },
+                        callback: !$.isFunction(callback) ? $.noop : function() {
+                            callback(match);
+                        }
+                    });
+                };
+            }
+
+            return opts;
+        },
+
+        // single
+        getPlaceholder: function() {
+            // if a placeholder is specified on a single select without a valid placeholder option ignore it
+            if (this.select) {
+                if (this.getPlaceholderOption() === undefined) {
+                    return undefined;
+                }
+            }
+
+            return this.parent.getPlaceholder.apply(this, arguments);
+        },
+
+        // single
+        setPlaceholder: function () {
+            var placeholder = this.getPlaceholder();
+
+            if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
+
+                // check for a placeholder option if attached to a select
+                if (this.select && this.getPlaceholderOption() === undefined) return;
+
+                this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
+
+                this.selection.addClass("select2-default");
+
+                this.container.removeClass("select2-allowclear");
+            }
+        },
+
+        // single
+        postprocessResults: function (data, initial, noHighlightUpdate) {
+            var selected = 0, self = this, showSearchInput = true;
+
+            // find the selected element in the result list
+
+            this.findHighlightableChoices().each2(function (i, elm) {
+                if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
+                    selected = i;
+                    return false;
+                }
+            });
+
+            // and highlight it
+            if (noHighlightUpdate !== false) {
+                if (initial === true && selected >= 0) {
+                    this.highlight(selected);
+                } else {
+                    this.highlight(0);
+                }
+            }
+
+            // hide the search box if this is the first we got the results and there are enough of them for search
+
+            if (initial === true) {
+                var min = this.opts.minimumResultsForSearch;
+                if (min >= 0) {
+                    this.showSearch(countResults(data.results) >= min);
+                }
+            }
+        },
+
+        // single
+        showSearch: function(showSearchInput) {
+            if (this.showSearchInput === showSearchInput) return;
+
+            this.showSearchInput = showSearchInput;
+
+            this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
+            this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
+            //add "select2-with-searchbox" to the container if search box is shown
+            $(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
+        },
+
+        // single
+        onSelect: function (data, options) {
+
+            if (!this.triggerSelect(data)) { return; }
+
+            var old = this.opts.element.val(),
+                oldData = this.data();
+
+            this.opts.element.val(this.id(data));
+            this.updateSelection(data);
+
+            this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
+
+            this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
+            this.close();
+
+            if (!options || !options.noFocus)
+                this.focusser.focus();
+
+            if (!equal(old, this.id(data))) { this.triggerChange({added:data,removed:oldData}); }
+        },
+
+        // single
+        updateSelection: function (data) {
+
+            var container=this.selection.find(".select2-chosen"), formatted, cssClass;
+
+            this.selection.data("select2-data", data);
+
+            container.empty();
+            if (data !== null) {
+                formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
+            }
+            if (formatted !== undefined) {
+                container.append(formatted);
+            }
+            cssClass=this.opts.formatSelectionCssClass(data, container);
+            if (cssClass !== undefined) {
+                container.addClass(cssClass);
+            }
+
+            this.selection.removeClass("select2-default");
+
+            if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
+                this.container.addClass("select2-allowclear");
+            }
+        },
+
+        // single
+        val: function () {
+            var val,
+                triggerChange = false,
+                data = null,
+                self = this,
+                oldData = this.data();
+
+            if (arguments.length === 0) {
+                return this.opts.element.val();
+            }
+
+            val = arguments[0];
+
+            if (arguments.length > 1) {
+                triggerChange = arguments[1];
+            }
+
+            if (this.select) {
+                this.select
+                    .val(val)
+                    .find(":selected").each2(function (i, elm) {
+                        data = self.optionToData(elm);
+                        return false;
+                    });
+                this.updateSelection(data);
+                this.setPlaceholder();
+                if (triggerChange) {
+                    this.triggerChange({added: data, removed:oldData});
+                }
+            } else {
+                // val is an id. !val is true for [undefined,null,'',0] - 0 is legal
+                if (!val && val !== 0) {
+                    this.clear(triggerChange);
+                    return;
+                }
+                if (this.opts.initSelection === undefined) {
+                    throw new Error("cannot call val() if initSelection() is not defined");
+                }
+                this.opts.element.val(val);
+                this.opts.initSelection(this.opts.element, function(data){
+                    self.opts.element.val(!data ? "" : self.id(data));
+                    self.updateSelection(data);
+                    self.setPlaceholder();
+                    if (triggerChange) {
+                        self.triggerChange({added: data, removed:oldData});
+                    }
+                });
+            }
+        },
+
+        // single
+        clearSearch: function () {
+            this.search.val("");
+            this.focusser.val("");
+        },
+
+        // single
+        data: function(value) {
+            var data,
+                triggerChange = false;
+
+            if (arguments.length === 0) {
+                data = this.selection.data("select2-data");
+                if (data == undefined) data = null;
+                return data;
+            } else {
+                if (arguments.length > 1) {
+                    triggerChange = arguments[1];
+                }
+                if (!value) {
+                    this.clear(triggerChange);
+                } else {
+                    data = this.data();
+                    this.opts.element.val(!value ? "" : this.id(value));
+                    this.updateSelection(value);
+                    if (triggerChange) {
+                        this.triggerChange({added: value, removed:data});
+                    }
+                }
+            }
+        }
+    });
+
+    MultiSelect2 = clazz(AbstractSelect2, {
+
+        // multi
+        createContainer: function () {
+            var container = $(document.createElement("div")).attr({
+                "class": "select2-container select2-container-multi"
+            }).html([
+                "<ul class='select2-choices'>",
+                "  <li class='select2-search-field'>",
+                "    <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
+                "  </li>",
+                "</ul>",
+                "<div class='select2-drop select2-drop-multi select2-display-none'>",
+                "   <ul class='select2-results'>",
+                "   </ul>",
+                "</div>"].join(""));
+            return container;
+        },
+
+        // multi
+        prepareOpts: function () {
+            var opts = this.parent.prepareOpts.apply(this, arguments),
+                self=this;
+
+            // TODO validate placeholder is a string if specified
+
+            if (opts.element.get(0).tagName.toLowerCase() === "select") {
+                // install sthe selection initializer
+                opts.initSelection = function (element, callback) {
+
+                    var data = [];
+
+                    element.find(":selected").each2(function (i, elm) {
+                        data.push(self.optionToData(elm));
+                    });
+                    callback(data);
+                };
+            } else if ("data" in opts) {
+                // install default initSelection when applied to hidden input and data is local
+                opts.initSelection = opts.initSelection || function (element, callback) {
+                    var ids = splitVal(element.val(), opts.separator);
+                    //search in data by array of ids, storing matching items in a list
+                    var matches = [];
+                    opts.query({
+                        matcher: function(term, text, el){
+                            var is_match = $.grep(ids, function(id) {
+                                return equal(id, opts.id(el));
+                            }).length;
+                            if (is_match) {
+                                matches.push(el);
+                            }
+                            return is_match;
+                        },
+                        callback: !$.isFunction(callback) ? $.noop : function() {
+                            // reorder matches based on the order they appear in the ids array because right now
+                            // they are in the order in which they appear in data array
+                            var ordered = [];
+                            for (var i = 0; i < ids.length; i++) {
+                                var id = ids[i];
+                                for (var j = 0; j < matches.length; j++) {
+                                    var match = matches[j];
+                                    if (equal(id, opts.id(match))) {
+                                        ordered.push(match);
+                                        matches.splice(j, 1);
+                                        break;
+                                    }
+                                }
+                            }
+                            callback(ordered);
+                        }
+                    });
+                };
+            }
+
+            return opts;
+        },
+
+        selectChoice: function (choice) {
+
+            var selected = this.container.find(".select2-search-choice-focus");
+            if (selected.length && choice && choice[0] == selected[0]) {
+
+            } else {
+                if (selected.length) {
+                    this.opts.element.trigger("choice-deselected", selected);
+                }
+                selected.removeClass("select2-search-choice-focus");
+                if (choice && choice.length) {
+                    this.close();
+                    choice.addClass("select2-search-choice-focus");
+                    this.opts.element.trigger("choice-selected", choice);
+                }
+            }
+        },
+
+        // multi
+        destroy: function() {
+            $("label[for='" + this.search.attr('id') + "']")
+                .attr('for', this.opts.element.attr("id"));
+            this.parent.destroy.apply(this, arguments);
+        },
+
+        // multi
+        initContainer: function () {
+
+            var selector = ".select2-choices", selection;
+
+            this.searchContainer = this.container.find(".select2-search-field");
+            this.selection = selection = this.container.find(selector);
+
+            var _this = this;
+            this.selection.on("click", ".select2-search-choice:not(.select2-locked)", function (e) {
+                //killEvent(e);
+                _this.search[0].focus();
+                _this.selectChoice($(this));
+            });
+
+            // rewrite labels from original element to focusser
+            this.search.attr("id", "s2id_autogen"+nextUid());
+            $("label[for='" + this.opts.element.attr("id") + "']")
+                .attr('for', this.search.attr('id'));
+
+            this.search.on("input paste", this.bind(function() {
+                if (!this.isInterfaceEnabled()) return;
+                if (!this.opened()) {
+                    this.open();
+                }
+            }));
+
+            this.search.attr("tabindex", this.elementTabIndex);
+
+            this.keydowns = 0;
+            this.search.on("keydown", this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+
+                ++this.keydowns;
+                var selected = selection.find(".select2-search-choice-focus");
+                var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
+                var next = selected.next(".select2-search-choice:not(.select2-locked)");
+                var pos = getCursorInfo(this.search);
+
+                if (selected.length &&
+                    (e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
+                    var selectedChoice = selected;
+                    if (e.which == KEY.LEFT && prev.length) {
+                        selectedChoice = prev;
+                    }
+                    else if (e.which == KEY.RIGHT) {
+                        selectedChoice = next.length ? next : null;
+                    }
+                    else if (e.which === KEY.BACKSPACE) {
+                        this.unselect(selected.first());
+                        this.search.width(10);
+                        selectedChoice = prev.length ? prev : next;
+                    } else if (e.which == KEY.DELETE) {
+                        this.unselect(selected.first());
+                        this.search.width(10);
+                        selectedChoice = next.length ? next : null;
+                    } else if (e.which == KEY.ENTER) {
+                        selectedChoice = null;
+                    }
+
+                    this.selectChoice(selectedChoice);
+                    killEvent(e);
+                    if (!selectedChoice || !selectedChoice.length) {
+                        this.open();
+                    }
+                    return;
+                } else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
+                    || e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
+
+                    this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
+                    killEvent(e);
+                    return;
+                } else {
+                    this.selectChoice(null);
+                }
+
+                if (this.opened()) {
+                    switch (e.which) {
+                    case KEY.UP:
+                    case KEY.DOWN:
+                        this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
+                        killEvent(e);
+                        return;
+                    case KEY.ENTER:
+                        this.selectHighlighted();
+                        killEvent(e);
+                        return;
+                    case KEY.TAB:
+                        this.selectHighlighted({noFocus:true});
+                        this.close();
+                        return;
+                    case KEY.ESC:
+                        this.cancel(e);
+                        killEvent(e);
+                        return;
+                    }
+                }
+
+                if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
+                 || e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
+                    return;
+                }
+
+                if (e.which === KEY.ENTER) {
+                    if (this.opts.openOnEnter === false) {
+                        return;
+                    } else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
+                        return;
+                    }
+                }
+
+                this.open();
+
+                if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
+                    // prevent the page from scrolling
+                    killEvent(e);
+                }
+
+                if (e.which === KEY.ENTER) {
+                    // prevent form from being submitted
+                    killEvent(e);
+                }
+
+            }));
+
+            this.search.on("keyup", this.bind(function (e) {
+                this.keydowns = 0;
+                this.resizeSearch();
+            })
+            );
+
+            this.search.on("blur", this.bind(function(e) {
+                this.container.removeClass("select2-container-active");
+                this.search.removeClass("select2-focused");
+                this.selectChoice(null);
+                if (!this.opened()) this.clearSearch();
+                e.stopImmediatePropagation();
+                this.opts.element.trigger($.Event("select2-blur"));
+            }));
+
+            this.container.on("click", selector, this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+                if ($(e.target).closest(".select2-search-choice").length > 0) {
+                    // clicked inside a select2 search choice, do not open
+                    return;
+                }
+                this.selectChoice(null);
+                this.clearPlaceholder();
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+                this.open();
+                this.focusSearch();
+                e.preventDefault();
+            }));
+
+            this.container.on("focus", selector, this.bind(function () {
+                if (!this.isInterfaceEnabled()) return;
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+                this.container.addClass("select2-container-active");
+                this.dropdown.addClass("select2-drop-active");
+                this.clearPlaceholder();
+            }));
+
+            this.initContainerWidth();
+            this.opts.element.addClass("select2-offscreen");
+
+            // set the placeholder if necessary
+            this.clearSearch();
+        },
+
+        // multi
+        enableInterface: function() {
+            if (this.parent.enableInterface.apply(this, arguments)) {
+                this.search.prop("disabled", !this.isInterfaceEnabled());
+            }
+        },
+
+        // multi
+        initSelection: function () {
+            var data;
+            if (this.opts.element.val() === "" && this.opts.element.text() === "") {
+                this.updateSelection([]);
+                this.close();
+                // set the placeholder if necessary
+                this.clearSearch();
+            }
+            if (this.select || this.opts.element.val() !== "") {
+                var self = this;
+                this.opts.initSelection.call(null, this.opts.element, function(data){
+                    if (data !== undefined && data !== null) {
+                        self.updateSelection(data);
+                        self.close();
+                        // set the placeholder if necessary
+                        self.clearSearch();
+                    }
+                });
+            }
+        },
+
+        // multi
+        clearSearch: function () {
+            var placeholder = this.getPlaceholder(),
+                maxWidth = this.getMaxSearchWidth();
+
+            if (placeholder !== undefined  && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
+                this.search.val(placeholder).addClass("select2-default");
+                // stretch the search box to full width of the container so as much of the placeholder is visible as possible
+                // we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
+                this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
+            } else {
+                this.search.val("").width(10);
+            }
+        },
+
+        // multi
+        clearPlaceholder: function () {
+            if (this.search.hasClass("select2-default")) {
+                this.search.val("").removeClass("select2-default");
+            }
+        },
+
+        // multi
+        opening: function () {
+            this.clearPlaceholder(); // should be done before super so placeholder is not used to search
+            this.resizeSearch();
+
+            this.parent.opening.apply(this, arguments);
+
+            this.focusSearch();
+
+            this.updateResults(true);
+            this.search.focus();
+            this.opts.element.trigger($.Event("select2-open"));
+        },
+
+        // multi
+        close: function () {
+            if (!this.opened()) return;
+            this.parent.close.apply(this, arguments);
+        },
+
+        // multi
+        focus: function () {
+            this.close();
+            this.search.focus();
+        },
+
+        // multi
+        isFocused: function () {
+            return this.search.hasClass("select2-focused");
+        },
+
+        // multi
+        updateSelection: function (data) {
+            var ids = [], filtered = [], self = this;
+
+            // filter out duplicates
+            $(data).each(function () {
+                if (indexOf(self.id(this), ids) < 0) {
+                    ids.push(self.id(this));
+                    filtered.push(this);
+                }
+            });
+            data = filtered;
+
+            this.selection.find(".select2-search-choice").remove();
+            $(data).each(function () {
+                self.addSelectedChoice(this);
+            });
+            self.postprocessResults();
+        },
+
+        // multi
+        tokenize: function() {
+            var input = this.search.val();
+            input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
+            if (input != null && input != undefined) {
+                this.search.val(input);
+                if (input.length > 0) {
+                    this.open();
+                }
+            }
+
+        },
+
+        // multi
+        onSelect: function (data, options) {
+
+            if (!this.triggerSelect(data)) { return; }
+
+            this.addSelectedChoice(data);
+
+            this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
+
+            if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
+
+            if (this.opts.closeOnSelect) {
+                this.close();
+                this.search.width(10);
+            } else {
+                if (this.countSelectableResults()>0) {
+                    this.search.width(10);
+                    this.resizeSearch();
+                    if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
+                        // if we reached max selection size repaint the results so choices
+                        // are replaced with the max selection reached message
+                        this.updateResults(true);
+                    }
+                    this.positionDropdown();
+                } else {
+                    // if nothing left to select close
+                    this.close();
+                    this.search.width(10);
+                }
+            }
+
+            // since its not possible to select an element that has already been
+            // added we do not need to check if this is a new element before firing change
+            this.triggerChange({ added: data });
+
+            if (!options || !options.noFocus)
+                this.focusSearch();
+        },
+
+        // multi
+        cancel: function () {
+            this.close();
+            this.focusSearch();
+        },
+
+        addSelectedChoice: function (data) {
+            var enableChoice = !data.locked,
+                enabledItem = $(
+                    "<li class='select2-search-choice'>" +
+                    "    <div></div>" +
+                    "    <a href='#' onclick='return false;' class='select2-search-choice-close' tabindex='-1'></a>" +
+                    "</li>"),
+                disabledItem = $(
+                    "<li class='select2-search-choice select2-locked'>" +
+                    "<div></div>" +
+                    "</li>");
+            var choice = enableChoice ? enabledItem : disabledItem,
+                id = this.id(data),
+                val = this.getVal(),
+                formatted,
+                cssClass;
+
+            formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
+            if (formatted != undefined) {
+                choice.find("div").replaceWith("<div>"+formatted+"</div>");
+            }
+            cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
+            if (cssClass != undefined) {
+                choice.addClass(cssClass);
+            }
+
+            if(enableChoice){
+              choice.find(".select2-search-choice-close")
+                  .on("mousedown", killEvent)
+                  .on("click dblclick", this.bind(function (e) {
+                  if (!this.isInterfaceEnabled()) return;
+
+                  $(e.target).closest(".select2-search-choice").fadeOut('fast', this.bind(function(){
+                      this.unselect($(e.target));
+                      this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
+                      this.close();
+                      this.focusSearch();
+                  })).dequeue();
+                  killEvent(e);
+              })).on("focus", this.bind(function () {
+                  if (!this.isInterfaceEnabled()) return;
+                  this.container.addClass("select2-container-active");
+                  this.dropdown.addClass("select2-drop-active");
+              }));
+            }
+
+            choice.data("select2-data", data);
+            choice.insertBefore(this.searchContainer);
+
+            val.push(id);
+            this.setVal(val);
+        },
+
+        // multi
+        unselect: function (selected) {
+            var val = this.getVal(),
+                data,
+                index;
+
+            selected = selected.closest(".select2-search-choice");
+
+            if (selected.length === 0) {
+                throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
+            }
+
+            data = selected.data("select2-data");
+
+            if (!data) {
+                // prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
+                // and invoked on an element already removed
+                return;
+            }
+
+            while((index = indexOf(this.id(data), val)) >= 0) {
+                val.splice(index, 1);
+                this.setVal(val);
+                if (this.select) this.postprocessResults();
+            }
+            selected.remove();
+
+            this.opts.element.trigger({ type: "removed", val: this.id(data), choice: data });
+            this.triggerChange({ removed: data });
+        },
+
+        // multi
+        postprocessResults: function (data, initial, noHighlightUpdate) {
+            var val = this.getVal(),
+                choices = this.results.find(".select2-result"),
+                compound = this.results.find(".select2-result-with-children"),
+                self = this;
+
+            choices.each2(function (i, choice) {
+                var id = self.id(choice.data("select2-data"));
+                if (indexOf(id, val) >= 0) {
+                    choice.addClass("select2-selected");
+                    // mark all children of the selected parent as selected
+                    choice.find(".select2-result-selectable").addClass("select2-selected");
+                }
+            });
+
+            compound.each2(function(i, choice) {
+                // hide an optgroup if it doesnt have any selectable children
+                if (!choice.is('.select2-result-selectable')
+                    && choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
+                    choice.addClass("select2-selected");
+                }
+            });
+
+            if (this.highlight() == -1 && noHighlightUpdate !== false){
+                self.highlight(0);
+            }
+
+            //If all results are chosen render formatNoMAtches
+            if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
+                if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
+                    if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
+                        this.results.append("<li class='select2-no-results'>" + self.opts.formatNoMatches(self.search.val()) + "</li>");
+                    }
+                }
+            }
+
+        },
+
+        // multi
+        getMaxSearchWidth: function() {
+            return this.selection.width() - getSideBorderPadding(this.search);
+        },
+
+        // multi
+        resizeSearch: function () {
+            var minimumWidth, left, maxWidth, containerLeft, searchWidth,
+                sideBorderPadding = getSideBorderPadding(this.search);
+
+            minimumWidth = measureTextWidth(this.search) + 10;
+
+            left = this.search.offset().left;
+
+            maxWidth = this.selection.width();
+            containerLeft = this.selection.offset().left;
+
+            searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
+
+            if (searchWidth < minimumWidth) {
+                searchWidth = maxWidth - sideBorderPadding;
+            }
+
+            if (searchWidth < 40) {
+                searchWidth = maxWidth - sideBorderPadding;
+            }
+
+            if (searchWidth <= 0) {
+              searchWidth = minimumWidth;
+            }
+
+            this.search.width(Math.floor(searchWidth));
+        },
+
+        // multi
+        getVal: function () {
+            var val;
+            if (this.select) {
+                val = this.select.val();
+                return val === null ? [] : val;
+            } else {
+                val = this.opts.element.val();
+                return splitVal(val, this.opts.separator);
+            }
+        },
+
+        // multi
+        setVal: function (val) {
+            var unique;
+            if (this.select) {
+                this.select.val(val);
+            } else {
+                unique = [];
+                // filter out duplicates
+                $(val).each(function () {
+                    if (indexOf(this, unique) < 0) unique.push(this);
+                });
+                this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
+            }
+        },
+
+        // multi
+        buildChangeDetails: function (old, current) {
+            var current = current.slice(0),
+                old = old.slice(0);
+
+            // remove intersection from each array
+            for (var i = 0; i < current.length; i++) {
+                for (var j = 0; j < old.length; j++) {
+                    if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
+                        current.splice(i, 1);
+                        i--;
+                        old.splice(j, 1);
+                        j--;
+                    }
+                }
+            }
+
+            return {added: current, removed: old};
+        },
+
+
+        // multi
+        val: function (val, triggerChange) {
+            var oldData, self=this, changeDetails;
+
+            if (arguments.length === 0) {
+                return this.getVal();
+            }
+
+            oldData=this.data();
+            if (!oldData.length) oldData=[];
+
+            // val is an id. !val is true for [undefined,null,'',0] - 0 is legal
+            if (!val && val !== 0) {
+                this.opts.element.val("");
+                this.updateSelection([]);
+                this.clearSearch();
+                if (triggerChange) {
+                    this.triggerChange({added: this.data(), removed: oldData});
+                }
+                return;
+            }
+
+            // val is a list of ids
+            this.setVal(val);
+
+            if (this.select) {
+                this.opts.initSelection(this.select, this.bind(this.updateSelection));
+                if (triggerChange) {
+                    this.triggerChange(this.buildChangeDetails(oldData, this.data()));
+                }
+            } else {
+                if (this.opts.initSelection === undefined) {
+                    throw new Error("val() cannot be called if initSelection() is not defined");
+                }
+
+                this.opts.initSelection(this.opts.element, function(data){
+                    var ids=$.map(data, self.id);
+                    self.setVal(ids);
+                    self.updateSelection(data);
+                    self.clearSearch();
+                    if (triggerChange) {
+                        self.triggerChange(self.buildChangeDetails(oldData, this.data()));
+                    }
+                });
+            }
+            this.clearSearch();
+        },
+
+        // multi
+        onSortStart: function() {
+            if (this.select) {
+                throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
+            }
+
+            // collapse search field into 0 width so its container can be collapsed as well
+            this.search.width(0);
+            // hide the container
+            this.searchContainer.hide();
+        },
+
+        // multi
+        onSortEnd:function() {
+
+            var val=[], self=this;
+
+            // show search and move it to the end of the list
+            this.searchContainer.show();
+            // make sure the search container is the last item in the list
+            this.searchContainer.appendTo(this.searchContainer.parent());
+            // since we collapsed the width in dragStarted, we resize it here
+            this.resizeSearch();
+
+            // update selection
+            this.selection.find(".select2-search-choice").each(function() {
+                val.push(self.opts.id($(this).data("select2-data")));
+            });
+            this.setVal(val);
+            this.triggerChange();
+        },
+
+        // multi
+        data: function(values, triggerChange) {
+            var self=this, ids, old;
+            if (arguments.length === 0) {
+                 return this.selection
+                     .find(".select2-search-choice")
+                     .map(function() { return $(this).data("select2-data"); })
+                     .get();
+            } else {
+                old = this.data();
+                if (!values) { values = []; }
+                ids = $.map(values, function(e) { return self.opts.id(e); });
+                this.setVal(ids);
+                this.updateSelection(values);
+                this.clearSearch();
+                if (triggerChange) {
+                    this.triggerChange(this.buildChangeDetails(old, this.data()));
+                }
+            }
+        }
+    });
+
+    $.fn.select2 = function () {
+
+        var args = Array.prototype.slice.call(arguments, 0),
+            opts,
+            select2,
+            method, value, multiple,
+            allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
+            valueMethods = ["opened", "isFocused", "container", "dropdown"],
+            propertyMethods = ["val", "data"],
+            methodsMap = { search: "externalSearch" };
+
+        this.each(function () {
+            if (args.length === 0 || typeof(args[0]) === "object") {
+                opts = args.length === 0 ? {} : $.extend({}, args[0]);
+                opts.element = $(this);
+
+                if (opts.element.get(0).tagName.toLowerCase() === "select") {
+                    multiple = opts.element.prop("multiple");
+                } else {
+                    multiple = opts.multiple || false;
+                    if ("tags" in opts) {opts.multiple = multiple = true;}
+                }
+
+                select2 = multiple ? new MultiSelect2() : new SingleSelect2();
+                select2.init(opts);
+            } else if (typeof(args[0]) === "string") {
+
+                if (indexOf(args[0], allowedMethods) < 0) {
+                    throw "Unknown method: " + args[0];
+                }
+
+                value = undefined;
+                select2 = $(this).data("select2");
+                if (select2 === undefined) return;
+
+                method=args[0];
+
+                if (method === "container") {
+                    value = select2.container;
+                } else if (method === "dropdown") {
+                    value = select2.dropdown;
+                } else {
+                    if (methodsMap[method]) method = methodsMap[method];
+
+                    value = select2[method].apply(select2, args.slice(1));
+                }
+                if (indexOf(args[0], valueMethods) >= 0
+                    || (indexOf(args[0], propertyMethods) && args.length == 1)) {
+                    return false; // abort the iteration, ready to return first matched value
+                }
+            } else {
+                throw "Invalid arguments to select2 plugin: " + args;
+            }
+        });
+        return (value === undefined) ? this : value;
+    };
+
+    // plugin defaults, accessible to users
+    $.fn.select2.defaults = {
+        width: "copy",
+        loadMorePadding: 0,
+        closeOnSelect: true,
+        openOnEnter: true,
+        containerCss: {},
+        dropdownCss: {},
+        containerCssClass: "",
+        dropdownCssClass: "",
+        formatResult: function(result, container, query, escapeMarkup) {
+            var markup=[];
+            markMatch(result.text, query.term, markup, escapeMarkup);
+            return markup.join("");
+        },
+        formatSelection: function (data, container, escapeMarkup) {
+            return data ? escapeMarkup(data.text) : undefined;
+        },
+        sortResults: function (results, container, query) {
+            return results;
+        },
+        formatResultCssClass: function(data) {return undefined;},
+        formatSelectionCssClass: function(data, container) {return undefined;},
+        formatNoMatches: function () { return "No matches found"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " more character" + (n == 1? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Loading more results..."; },
+        formatSearching: function () { return "Searching..."; },
+        minimumResultsForSearch: 0,
+        minimumInputLength: 0,
+        maximumInputLength: null,
+        maximumSelectionSize: 0,
+        id: function (e) { return e.id; },
+        matcher: function(term, text) {
+            return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
+        },
+        separator: ",",
+        tokenSeparators: [],
+        tokenizer: defaultTokenizer,
+        escapeMarkup: defaultEscapeMarkup,
+        blurOnChange: false,
+        selectOnBlur: false,
+        adaptContainerCssClass: function(c) { return c; },
+        adaptDropdownCssClass: function(c) { return null; },
+        nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; }
+    };
+
+    $.fn.select2.ajaxDefaults = {
+        transport: $.ajax,
+        params: {
+            type: "GET",
+            cache: false,
+            dataType: "json"
+        }
+    };
+
+    // exports
+    window.Select2 = {
+        query: {
+            ajax: ajax,
+            local: local,
+            tags: tags
+        }, util: {
+            debounce: debounce,
+            markMatch: markMatch,
+            escapeMarkup: defaultEscapeMarkup,
+            stripDiacritics: stripDiacritics
+        }, "class": {
+            "abstract": AbstractSelect2,
+            "single": SingleSelect2,
+            "multi": MultiSelect2
+        }
+    };
+
+}(jQuery));

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2.min.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2.min.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,22 @@
+/*
+Copyright 2012 Igor Vaynberg
+
+Version: 3.4.3 Timestamp: Tue Sep 17 06:47:14 PDT 2013
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License at:
+
+http://www.apache.org/licenses/LICENSE-2.0
+http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the Apache License
+or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
+either express or implied. See the Apache License and the GPL License for the specific language governing
+permissions and limitations under the Apache License and the GPL License.
+*/
+!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(a){var b,c,d,e;if(!a||a.length<1)return a;for(b="",c=0,d=a.length;d>c;c++)e=a.charAt(c),b+=m[e]||e;return b}function o(a,b){for(var c=0,d=b.length;d>c;c+=1)if(q(a,b[c]))return c;return-1}function p(){var b=a(l);b.appendTo("body");var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function q(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function r(b,c){var d,e,f;if(null===b||b.length<1)return[];for(d=b.split(c),e=0,f=d.length;f>e;e+=1)d[e]=a.trim(d[e]);return d}function s(a){return a.outerWidth(!1)-a.width()}function t(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("k
 eyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function u(c){c.on("mousemove",function(c){var d=i;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function v(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function w(a){var c,b=!1;return function(){return b===!1&&(c=a(),b=!0),c}}function x(a,b){var c=v(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){o(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus(),a.is(":visible")&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){
 b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!h){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);h=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),h.attr("class","select2-sizer"),a("body").append(h)}return h.text(b.val()),h.width()}function D(b,c,d){var e,g,f=[];e=b.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=c.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.pu
 sh(this))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=n(a.toUpperCase()).indexOf(n(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"&#92;","&":"&amp;","<":"&lt;",">":"&gt;",'"':"&quot;","'":"&#39;","/":"&#47;"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&e.abort(),c.params&&(a.isFunction(c.p
 arams)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page);i.callback(b)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]};a(d?c():c).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.match
 er(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g)}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;throw new Error(c+" must be a function or a falsy value")}function K(b){return a.isFunction(b)?b():b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(q(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var
  c,d,e,f,g,h,j,k,i={x:0,y:0},c={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case c.LEFT:case c.RIGHT:case c.UP:case c.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case c.SHIFT:case c.CTRL:case c.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","
 \u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\
 u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L
 ","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e5
 4":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","
 \u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a
 ","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\
 u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k"
 ,"\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"
 o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t"
 ,"\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"
 y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z"};j=a(document),g=function(){var a=1;return function(){return a++}}(),j.on("mousemove",function(a){i.x=a.pageX,i.y=a.pageY}),d=N(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,h,i,f=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+g()),this.containerSelector="#"+this.containerId.replace(/([;&,\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.body=w(function(){return c.element.closest("body")}),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this
 .container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss)),this.container.addClass(K(c.containerCssClass)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(f),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),u(this.results),this.dropdown.on("mousemove-filtered touchstart touchmove touchend",f,this.bind(this.highlightUnderEvent)),x(80,this.results),this.dropdown.on("scroll-debounced",f,this.bind(this.loadMoreIfNeeded)),a(this.containe
 r).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),t(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",f,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown",function(a){a.stopPropagation()}),a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b
 &&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),k=k||p(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.nextSearchTerm=b},destroy:function(){var a=this.opts.element,c=a.data("select2");this.close(),this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),c!==b&&(c.container.remove(),c.dropdown.remove(),a.removeClass("select2-offscreen").removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show())},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:q(a.attr("locked"),"locked")||q(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,f,g,h=this;if(d=c.
 element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,f){var g,l=this.opts.id;g=function(d,e,i){var j,k,m,n,o,p,q,r,s,t;for(d=c.sortResults(d,e,f),j=0,k=d.length;k>j;j+=1)m=d[j],o=m.disabled===!0,n=!o&&l(m)!==b,p=m.children&&m.children.length>0,q=a("<li></li>"),q.addClass("select2-results-dept-"+i),q.addClass("select2-result"),q.addClass(n?"select2-result-selectable":"select2-result-unselectable"),o&&q.addClass("select2-disabled"),p&&q.addClass("select2-result-with-children"),q.addClass(h.opts.formatResultCssClass(m)),r=a(document.createElement("div")),r.addClass("select2-result-label"),t=c.formatResult(m,r,f,h.opts.escapeMarkup),t!==b&&r.html(t),q.append(r),p&&(s=a("<ul></ul>"),s.addClass("s
 elect2-result-sub"),g(m.children,s,i+1),q.append(s)),q.data("select2-data",m),e.append(q)},g(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(f=c.id,c.id=function(a){return a[f]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,i,c={results:[],more:!1},e=a.term;i=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(h.optionToData(b)):b.is("optgroup")&&(d=h.optionToData(b),b.children().each2(function(a,b){i(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){i(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id},c.formatResultCssClass=function(a){return a.css}):"query"in c||("ajax"in c?(g=c.element.data("ajax-url"),g&&g.length>0
 &&(c.ajax.url=g),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(r(b.val(),c.separator)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return q(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");return c},monitorSource:function(){var c,a=this.opts.element;a.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),c=this.bind(function(){var d,f=a.prop("disabled");f===b&&(f=!1),this.enable(!f);var d=a.prop("readonly");d===b&&(d=!1),this.readonly(d),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerC
 ssClass)),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass))}),a.on("propertychange.select2 DOMAttrModified.select2",c),this.mutationCallback===b&&(this.mutationCallback=function(a){a.forEach(c)}),"undefined"!=typeof WebKitMutationObserver&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new WebKitMutationObserver(this.mutationCallback),this.propertyObserver.observe(a.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceE
 nabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){return a===b&&(a=!1),this._readonly===a?!1:(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface(),!0)},opened:function(){return this.container.hasClass("select2-dropdown-open")},positionDropdown:function(){var q,r,s,t,b=this.dropdown,c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),g=a(window).scrollLeft()+a(window).width(),h=a(window).scrollTop()+a(window).height(),i=c.top+d,j=c.left,l=h>=i+f,m=c.top-f>=this.body().scrollTop(),n=b.outerWidth(!1),o=g>
 =j+n,p=b.hasClass("select2-drop-above");this.opts.dropdownAutoWidth?(t=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),n=b.outerWidth(!1)+(t.scrollHeight===t.clientHeight?0:k.width),n>e?e=n:n=e,o=g>=j+n):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body().css("position")&&(q=this.body().offset(),i-=q.top,j-=q.left),p?(r=!0,!m&&l&&(r=!1)):(r=!1,!l&&m&&(r=!0)),o||(j=c.left+e-n),r?(i=c.top-f,this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),s=a.extend({top:i,left:j,width:e},K(this.opts.dropdownCss)),b.css(s)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("
 select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),!0):!1},opening:function(){var f,b=this.containerId,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body().children().last()[0]&&this.dropdown.detach().appendTo(this.body()),f=a("#select2-drop-mask"),0==f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body()),f.on("mousedown touchstart click",function(b){var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close({focus:!1}),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.sho
 w(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var h=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){h.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerId,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,b=this.
 results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),f=e.offset().top+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!0),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=e.offset().top-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?o(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.
 length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.ensureHighlightVisible(),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),e=this.resultsPage+1,f=this,g=this.search.val(),h=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:g,page:e,contex
 t:h,matcher:this.opts.matcher,callback:this.bind(function(c){f.opened()&&(f.opts.populateResults.call(this,a,c.results,{term:g,page:e,context:h}),f.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).text(f.opts.formatLoadMore(e+1)),window.setTimeout(function(){f.loadMoreIfNeeded()},10)):b.remove(),f.positionDropdown(),f.resultsPage=e,f.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown()}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!q(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li c
 lass='select2-selection-limit'>"+f.formatSelectionTooBig(o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+f.formatInputTooShort(d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+f.formatInputTooLong(d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;
+f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+f.formatSearching()+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return q(h.id(this),h.id(i))}).length&&g.results.unshift(i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+f.formatNoMatches(d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.results
 Page,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+h.opts.escapeMarkup(f.formatLoadMore(this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this
 .opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var a=this.select.children().first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&a||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.text()&&""===a.val())return a}},initContainerWidth:function(){function c(){var c,d,e,f,g;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(e=d[f].replace(/\s/g,"").match(/[^-]width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];ret
 urn"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),e=N(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' onclick='return false;' class='select2-choice' tabindex='-1'>","   <span class='select2-chosen'>&nbsp;</span><abbr class='select2-search-choice-close'></abbr>","   <span class='select2-arrow'><b></b></span>","</a>","<input class='select2-focusser select2-offscreen' type='text'/>","<div class='select2-drop select2-display-none'>","   <div class='select2-search'>","       <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'/>","   </div>","   <ul class='select2-results'>"
 ,"   </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e)),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(a){this.opened()&&(this.parent.close.apply(this,arguments),a=a||{focus:!0},this.focusser.removeAttr("disabled"),a.focus&&this.focusser.focus())},focus:function(){this.opened()?this.close():(thi
 s.focusser.removeAttr("disabled"),this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.removeAttr("disabled"),this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments)},initContainer:function(){var b,d=this.container,e=this.dropdown;this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=d.find(".select2-choice"),this.focusser=d.find(".select2-focusser"),this.focusser.attr("id","s2id_autogen"+g()),a("label[for='"+this.opts.element.attr("id")+"']").attr("for",this.focusser.attr("id")),this.focusser.attr("tabindex",this.elementTabIndex),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){if(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)return A(a),void 0;switch(a.which){case c.UP:case
  c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case c.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body().get(0)&&window.setTimeout(this.bind(function(){this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.ESC){if(this.opts.openOnEnter===!1&&a.which===c.ENTER)return A(a),void 0;if(a.which==c.DOWN||a.which==c.UP||a.which==c.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==c.DELETE||a.which==c.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),t(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearc
 h>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection.focus())})),b.on("mousedown",this.bind(function(b){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(b)})),e.on("mousedown",this.bind(function(){this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts
 .element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder())})}},isPlaceholderOptionSelected:function(){var a;return t
 his.getPlaceholder()?(a=this.getPlaceholderOption())!==b&&a.is(":selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val():!1},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find(":selected");b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=q(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-defau
 lt"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return q(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clos
 e(),b&&b.noFocus||this.focusser.focus(),q(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find(":selected").each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initS
 election() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),f=N(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>","  <li class='select2-search-field'>","    <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>","  </li>","</ul>","<div class='select2-drop select2-drop-multi sel
 ect2-display-none'>","   <ul class='select2-results'>","   </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find(":selected").each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=r(c.val(),b.separator),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return q(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(q(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("se
 lect2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments)},initContainer:function(){var d,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=d=this.container.find(b);var e=this;this.selection.on("click",".select2-search-choice:not(.select2-locked)",function(){e.search[0].focus(),e.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+g()),a("label[for='"+this.opts.element.attr("id")+"']").attr("for",this.search.attr("id")),this.search.on("input paste",this.bind(function(){this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=d.find(".select2-search-choice-focus"),e=b.prev(".select2-searc
 h-choice:not(.select2-locked)"),f=b.next(".select2-search-choice:not(.select2-locked)"),g=z(this.search);if(b.length&&(a.which==c.LEFT||a.which==c.RIGHT||a.which==c.BACKSPACE||a.which==c.DELETE||a.which==c.ENTER)){var h=b;return a.which==c.LEFT&&e.length?h=e:a.which==c.RIGHT?h=f.length?f:null:a.which===c.BACKSPACE?(this.unselect(b.first()),this.search.width(10),h=e.length?e:f):a.which==c.DELETE?(this.unselect(b.first()),this.search.width(10),h=f.length?f:null):a.which==c.ENTER&&(h=null),this.selectChoice(h),A(a),h&&h.length||this.open(),void 0}if((a.which===c.BACKSPACE&&1==this.keydowns||a.which==c.LEFT)&&0==g.offset&&!g.length)return this.selectChoice(d.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),this
 .close(),void 0;case c.ESC:return this.cancel(a),A(a),void 0}if(a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.BACKSPACE&&a.which!==c.ESC){if(a.which===c.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)&&A(a),a.which===c.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigge
 r(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this
 .getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),this.updateResults(!0),this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){o(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(functi
 on(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,b){this.triggerSelect(a)&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()&&this.updateResults(!0),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),b&&b.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-
 choice'>    <div></div>    <a href='#' onclick='return false;' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith("<div>"+j+"</div>"),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").fadeOut("fast",this.bind(function(){this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),this.close(),this.focusSearch()})).dequeue(),A(b))})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("sel
 ect2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(a){var c,d,b=this.getVal();if(a=a.closest(".select2-search-choice"),0===a.length)throw"Invalid argument: "+a+". Must be .select2-search-choice";if(c=a.data("select2-data")){for(;(d=o(this.id(c),b))>=0;)b.splice(d,1),this.setVal(b),this.select&&this.postprocessResults();a.remove(),this.opts.element.trigger({type:"removed",val:this.id(c),choice:c}),this.triggerChange({removed:c})}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));o(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!=
 =!1&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+g.opts.formatNoMatches(g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-s(this.search)},resizeSearch:function(){var a,b,c,d,e,f=s(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),r(a,this.opts.separator))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){o(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:functi
 on(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)q(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,this.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting 
 of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.find(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,g,h,i,j,c=Array.prototype.slice.call(arguments,0),k=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStar
 t","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],l=["opened","isFocused","container","dropdown"],m=["val","data"],n={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?j=d.element.prop("multiple"):(j=d.multiple||!1,"tags"in d&&(d.multiple=j=!0)),g=j?new f:new e,g.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(o(c[0],k)<0)throw"Unknown method: "+c[0];if(i=b,g=a(this).data("select2"),g===b)return;if(h=c[0],"container"===h?i=g.container:"dropdown"===h?i=g.dropdown:(n[h]&&(h=n[h]),i=g[h].apply(g,c.slice(1))),o(c[0],l)>=0||o(c[0],m)&&1==c.length)return!1}}),i===b?this:i},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];
 return E(a.text,c.term,e,d),e.join("")},formatSelection:function(a,c,d){return a?d(a.text):b},sortResults:function(a){return a},formatResultCssClass:function(){return b},formatSelectionCssClass:function(){return b},formatNoMatches:function(){return"No matches found"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results..."},formatSearching:function(){return"Searching..."},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a.id},matcher:function(a,b){return n(""+b).toUpperCase().indexOf(n(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainer
 CssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b}},a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:v,markMatch:E,escapeMarkup:F,stripDiacritics:n},"class":{"abstract":d,single:e,multi:f}}}}(jQuery);
\ No newline at end of file

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ar.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ar.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 Arabic translation.
+ * 
+ * Author: Your Name <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "لا توجد نتائج"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "من فضلك أدخل " + n + " حروف أكثر"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "من فضلك أحذف  " + n + " حروف"; },
+        formatSelectionTooBig: function (limit) { return "يمكنك ان تختار " + limit + " أختيارات فقط"; },
+        formatLoadMore: function (pageNumber) { return "تحمل المذيد من النتائج ..."; },
+        formatSearching: function () { return "جاري البحث ..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_bg.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_bg.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 <Language> translation.
+ * 
+ * Author: Lubomir Vikev <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Няма намерени съвпадения"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n == 1 ? "" : "а"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n == 1? "" : "а"); },
+        formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit == 1 ? " избор" : " избора"); },
+        formatLoadMore: function (pageNumber) { return "Зареждат се още..."; },
+        formatSearching: function () { return "Търсене..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ca.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ca.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 Catalan translation.
+ * 
+ * Author: David Planella <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
+        formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats..."; },
+        formatSearching: function () { return "S'està cercant..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_cs.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_cs.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,49 @@
+/**
+ * Select2 Czech translation.
+ * 
+ * Author: Michal Marek <[email protected]>
+ * Author - sklonovani: David Vallner <[email protected]>
+ */
+(function ($) {
+    "use strict";
+    // use text for the numbers 2 through 4
+    var smallNumbers = {
+        2: function(masc) { return (masc ? "dva" : "dvě"); },
+        3: function() { return "tři"; },
+        4: function() { return "čtyři"; }
+    }
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nenalezeny žádné položky"; },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            if (n == 1) {
+                return "Prosím zadejte ještě jeden znak";
+            } else if (n <= 4) {
+                return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
+            } else {
+                return "Prosím zadejte ještě dalších "+n+" znaků";
+            }
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            if (n == 1) {
+                return "Prosím zadejte o jeden znak méně";
+            } else if (n <= 4) {
+                return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
+            } else {
+                return "Prosím zadejte o "+n+" znaků méně";
+            }
+        },
+        formatSelectionTooBig: function (limit) {
+            if (limit == 1) {
+                return "Můžete zvolit jen jednu položku";
+            } else if (limit <= 4) {
+                return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
+            } else {
+                return "Můžete zvolit maximálně "+limit+" položek";
+            }
+        },
+        formatLoadMore: function (pageNumber) { return "Načítají se další výsledky..."; },
+        formatSearching: function () { return "Vyhledávání..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_da.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_da.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 Danish translation.
+ *
+ * Author: Anders Jenbo <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Ingen resultater fundet"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
+        formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
+        formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
+        formatSearching: function () { return "Søger…"; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_de.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_de.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,15 @@
+/**
+ * Select2 German translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
+        formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
+        formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse..."; },
+        formatSearching: function () { return "Suche..."; }
+    });
+})(jQuery);
\ No newline at end of file

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_el.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_el.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 <Language> translation.
+ * 
+ * Author: Your Name <your@email>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερους χαρακτήρες" + (n == 1 ? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρες" + (n == 1 ? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμενο" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων..."; },
+        formatSearching: function () { return "Αναζήτηση..."; }
+    });
+})(jQuery);
\ No newline at end of file

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_en.js.template
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_en.js.template	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 <Language> translation.
+ * 
+ * Author: Your Name <your@email>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "No matches found"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " more character" + (n == 1 ? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Loading more results..."; },
+        formatSearching: function () { return "Searching..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_es.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_es.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,15 @@
+/**
+ * Select2 Spanish translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "No se encontraron resultados"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "á" : "a") + "cter" + (n == 1? "" : "es"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "á" : "a") + "cter" + (n == 1? "" : "es"); },
+        formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Cargando más resultados..."; },
+        formatSearching: function () { return "Buscando..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_et.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_et.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 Estonian translation.
+ *
+ * Author: Kuldar Kalvik <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Tulemused puuduvad"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
+        formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
+        formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
+        formatSearching: function () { return "Otsin.."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_eu.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_eu.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,43 @@
+/**
+ * Select2 Basque translation.
+ *
+ * Author: Julen Ruiz Aizpuru <julenx at gmail dot com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () {
+          return "Ez da bat datorrenik aurkitu";
+        },
+        formatInputTooShort: function (input, min) {
+          var n = min - input.length;
+          if (n === 1) {
+            return "Idatzi karaktere bat gehiago";
+          } else {
+            return "Idatzi " + n + " karaktere gehiago";
+          }
+        },
+        formatInputTooLong: function (input, max) {
+          var n = input.length - max;
+          if (n === 1) {
+            return "Idatzi karaktere bat gutxiago";
+          } else {
+            return "Idatzi " + n + " karaktere gutxiago";
+          }
+        },
+        formatSelectionTooBig: function (limit) {
+          if (limit === 1 ) {
+            return "Elementu bakarra hauta dezakezu";
+          } else {
+            return limit + " elementu hauta ditzakezu soilik";
+          }
+        },
+        formatLoadMore: function (pageNumber) {
+          return "Emaitza gehiago kargatzen...";
+        },
+        formatSearching: function () {
+          return "Bilatzen...";
+        }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_fa.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_fa.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 <fa> translation.
+ * 
+ * Author: Ali Choopan <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "نتیجه‌ای یافت نشد."; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return " لطفا بیش از"+n+"کاراکتر وارد نمایید "; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return " لطفا" + n + " کاراکتر را حذف کنید."; },
+        formatSelectionTooBig: function (limit) { return "شما فقط می‌توانید " + limit + " مورد را انتخاب کنید"; },
+        formatLoadMore: function (pageNumber) { return "در حال بارگذاری موارد بیشتر ..."; },
+        formatSearching: function () { return "در حال جستجو"; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_fi.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_fi.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,28 @@
+/**
+ * Select2 Finnish translation
+ */
+(function ($) {
+    "use strict";
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () {
+            return "Ei tuloksia";
+        },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            return "Ole hyvä ja anna " + n + " merkkiä lisää.";
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            return "Ole hyvä ja annar " + n + " merkkiä vähemmän.";
+        },
+        formatSelectionTooBig: function (limit) {
+            return "Voit valita ainoastaan " + limit + " kpl";
+        },
+        formatLoadMore: function (pageNumber) {
+            return "Ladataan lisää tuloksia...";
+        },
+        formatSearching: function () {
+            return "Etsitään...";
+        }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_fr.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_fr.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,15 @@
+/**
+ * Select2 French translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Aucun résultat trouvé"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Merci de saisir " + n + " caractère" + (n == 1? "" : "s") + " de plus"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Merci de supprimer " + n + " caractère" + (n == 1? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires..."; },
+        formatSearching: function () { return "Recherche en cours..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_gl.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_gl.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,43 @@
+/**
+ * Select2 Galician translation
+ * 
+ * Author: Leandro Regueiro <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () {
+            return "Non se atoparon resultados";
+        },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            if (n === 1) {
+                return "Engada un carácter";
+            } else {
+                return "Engada " + n + " caracteres";
+            }
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            if (n === 1) {
+                return "Elimine un carácter";
+            } else {
+                return "Elimine " + n + " caracteres";
+            }
+        },
+        formatSelectionTooBig: function (limit) {
+            if (limit === 1 ) {
+                return "Só pode seleccionar un elemento";
+            } else {
+                return "Só pode seleccionar " + limit + " elementos";
+            }
+        },
+        formatLoadMore: function (pageNumber) {
+            return "Cargando máis resultados...";
+        },
+        formatSearching: function () {
+            return "Buscando...";
+        }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_he.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_he.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+* Select2 Hebrew translation.
+*
+* Author: Yakir Sitbon <http://www.yakirs.net/>
+*/
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "לא נמצאו התאמות"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
+        formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
+        formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות..."; },
+        formatSearching: function () { return "מחפש..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_hr.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_hr.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,42 @@
+/**
+ * Select2 Croatian translation.
+ *
+ * Author: Edi Modrić <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    var specialNumbers = {
+        1: function(n) { return (n % 100 != 11 ? "znak" : "znakova"); },
+        2: function(n) { return (n % 100 != 12 ? "znaka" : "znakova"); },
+        3: function(n) { return (n % 100 != 13 ? "znaka" : "znakova"); },
+        4: function(n) { return (n % 100 != 14 ? "znaka" : "znakova"); }
+    };
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nema rezultata"; },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            var nMod10 = n % 10;
+
+            if (nMod10 > 0 && nMod10 < 5) {
+                return "Unesite još " + n + " " + specialNumbers[nMod10](n);
+            }
+
+            return "Unesite još " + n + " znakova";
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            var nMod10 = n % 10;
+
+            if (nMod10 > 0 && nMod10 < 5) {
+                return "Unesite " + n + " " + specialNumbers[nMod10](n) + " manje";
+            }
+
+            return "Unesite " + n + " znakova manje";
+        },
+        formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
+        formatLoadMore: function (pageNumber) { return "Učitavanje rezultata..."; },
+        formatSearching: function () { return "Pretraga..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_hu.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_hu.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,15 @@
+/**
+ * Select2 Hungarian translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nincs találat."; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " kerekterrel több mint kellene."; },
+        formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
+        formatLoadMore: function (pageNumber) { return "Töltés..."; },
+        formatSearching: function () { return "Keresés..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_id.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_id.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 Indonesian translation.
+ * 
+ * Author: Ibrahim Yusuf <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Mengambil data..."; },
+        formatSearching: function () { return "Mencari..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_is.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_is.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,16 @@
+/**
+ * Select2 Icelandic translation.
+ * 
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Ekkert fannst"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n == 1 ? "" : "i") + " í viðbót"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n == 1 ? "" : "i"); },
+        formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
+        formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður..."; }, 
+        formatSearching: function () { return "Leita..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_it.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_it.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,15 @@
+/**
+ * Select2 Italian translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
+        formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
+        formatLoadMore: function (pageNumber) { return "Caricamento in corso..."; },
+        formatSearching: function () { return "Ricerca..."; }
+    });
+})(jQuery);
\ No newline at end of file

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ja.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ja.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,15 @@
+/**
+ * Select2 Japanese translation.
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "該当なし"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
+        formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
+        formatLoadMore: function (pageNumber) { return "読込中・・・"; },
+        formatSearching: function () { return "検索中・・・"; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ko.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ko.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 <Language> translation.
+ * 
+ * Author: Swen Mun <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "결과 없음"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
+        formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
+        formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
+        formatSearching: function () { return "검색 중…"; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_lt.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_lt.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,29 @@
+/**
+ * Select2 lithuanian translation.
+ * 
+ * Author: CRONUS Karmalakas <cronus dot karmalakas at gmail dot com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Atitikmenų nerasta"; },
+        formatInputTooShort: function (input, min) {
+        	var n = min - input.length,
+        	    suffix = (n % 10 == 1) && (n % 100 != 11) ? 'į' : (((n % 10 >= 2) && ((n % 100 < 10) || (n % 100 >= 20))) ? 'ius' : 'ių');
+        	return "Įrašykite dar " + n + " simbol" + suffix;
+        },
+        formatInputTooLong: function (input, max) {
+        	var n = input.length - max,
+        	    suffix = (n % 10 == 1) && (n % 100 != 11) ? 'į' : (((n % 10 >= 2) && ((n % 100 < 10) || (n % 100 >= 20))) ? 'ius' : 'ių');
+        	return "Pašalinkite " + n + " simbol" + suffix;
+        },
+        formatSelectionTooBig: function (limit) {
+        	var n = limit,
+                suffix = (n % 10 == 1) && (n % 100 != 11) ? 'ą' : (((n % 10 >= 2) && ((n % 100 < 10) || (n % 100 >= 20))) ? 'us' : 'ų');
+        	return "Jūs galite pasirinkti tik " + limit + " element" + suffix;
+        },
+        formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų..."; },
+        formatSearching: function () { return "Ieškoma..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_lv.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_lv.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,16 @@
+/**
+ * Select2 Latvian translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Sakritību nav"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : (/^\d*[1]$/im.test(n)? "u" : "us")); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : (/^\d*[1]$/im.test(n)? "u" : "iem")) + " mazāk"; },
+        formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : (/^\d*[1]$/im.test(limit)? "u" : "us")); },
+        formatLoadMore: function (pageNumber) { return "Datu ielāde..."; },
+        formatSearching: function () { return "Meklēšana..."; }
+    });
+	
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_mk.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_mk.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 Macedonian translation.
+ * 
+ * Author: Marko Aleksic <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
+        formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
+        formatLoadMore: function (pageNumber) { return "Вчитување резултати..."; },
+        formatSearching: function () { return "Пребарување..."; }
+    });
+})(jQuery);
\ No newline at end of file

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ms.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ms.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 Malay translation.
+ * 
+ * Author: Kepoweran <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Tiada padanan yang ditemui"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; },
+        formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; },
+        formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan..."; },
+        formatSearching: function () { return "Mencari..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_nl.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_nl.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,15 @@
+/**
+ * Select2 Dutch translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Geen resultaten gevonden"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul " + n + " karakter" + (n == 1? "" : "s") + " meer in"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vul " + n + " karakter" + (n == 1? "" : "s") + " minder in"; },
+        formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
+        formatLoadMore: function (pageNumber) { return "Meer resultaten laden..."; },
+        formatSearching: function () { return "Zoeken..."; }
+    });
+})(jQuery);
\ No newline at end of file

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_no.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_no.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,18 @@
+/**
+ * Select2 Norwegian translation.
+ *
+ * Author: Torgeir Veimo <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Ingen treff"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
+        formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
+        formatLoadMore: function (pageNumber) { return "Laster flere resultater..."; },
+        formatSearching: function () { return "Søker..."; }
+    });
+})(jQuery);
+

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_pl.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_pl.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,37 @@
+/**
+ * Select2 Polish translation.
+ * 
+ * Author: Jan Kondratowicz <[email protected]>
+ */
+(function ($) {
+    "use strict";
+    
+    var pl_suffix = function(n) {
+        if(n == 1) return "";
+        if((n%100 > 1 && n%100 < 5) || (n%100 > 20 && n%10 > 1 && n%10 < 5)) return "i";
+        return "ów";
+    };
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () {
+            return "Brak wyników.";
+        },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            return "Wpisz jeszcze " + n + " znak" + pl_suffix(n) + ".";
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            return "Wpisana fraza jest za długa o " + n + " znak" + pl_suffix(n) + ".";
+        },
+        formatSelectionTooBig: function (limit) {
+            return "Możesz zaznaczyć najwyżej " + limit + " element" + pl_suffix(limit) + ".";
+        },
+        formatLoadMore: function (pageNumber) {
+            return "Ładowanie wyników...";
+        },
+        formatSearching: function () {
+            return "Szukanie...";
+        }
+    });
+})(jQuery);
\ No newline at end of file

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_pt-BR.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_pt-BR.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,15 @@
+/**
+ * Select2 Brazilian Portuguese translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nenhum resultado encontrado"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Informe " + n + " caractere" + (n == 1? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caractere" + (n == 1? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Carregando mais resultados..."; },
+        formatSearching: function () { return "Buscando..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_pt-PT.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_pt-PT.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,15 @@
+/**
+ * Select2 Portuguese (Portugal) translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nenhum resultado encontrado"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
+        formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "A carregar mais resultados..."; },
+        formatSearching: function () { return "A pesquisar..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ro.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ro.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,15 @@
+/**
+ * Select2 Romanian translation.
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nu a fost găsit nimic"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
+        formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
+        formatLoadMore: function (pageNumber) { return "Se încarcă..."; },
+        formatSearching: function () { return "Căutare..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ru.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ru.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,15 @@
+/**
+ * Select2 Russian translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Совпадений не найдено"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Пожалуйста, введите еще " + n + " символ" + (n == 1 ? "" : ((n > 1)&&(n < 5) ? "а" : "ов")); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Пожалуйста, введите на " + n + " символ" + (n == 1 ? "" : ((n > 1)&&(n < 5)? "а" : "ов")) + " меньше"; },
+        formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit == 1 ? "а" : "ов"); },
+        formatLoadMore: function (pageNumber) { return "Загрузка данных..."; },
+        formatSearching: function () { return "Поиск..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_sk.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_sk.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,48 @@
+/**
+ * Select2 Slovak translation.
+ *
+ * Author: David Vallner <[email protected]>
+ */
+(function ($) {
+    "use strict";
+    // use text for the numbers 2 through 4
+    var smallNumbers = {
+        2: function(masc) { return (masc ? "dva" : "dve"); },
+        3: function() { return "tri"; },
+        4: function() { return "štyri"; }
+    }
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            if (n == 1) {
+                return "Prosím zadajte ešte jeden znak";
+            } else if (n <= 4) {
+                return "Prosím zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
+            } else {
+                return "Prosím zadajte ešte ďalších "+n+" znakov";
+            }
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            if (n == 1) {
+                return "Prosím zadajte o jeden znak menej";
+            } else if (n <= 4) {
+                return "Prosím zadajte o "+smallNumbers[n](true)+" znaky menej";
+            } else {
+                return "Prosím zadajte o "+n+" znakov menej";
+            }
+        },
+        formatSelectionTooBig: function (limit) {
+            if (limit == 1) {
+                return "Môžete zvoliť len jednu položku";
+            } else if (limit <= 4) {
+                return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
+            } else {
+                return "Môžete zvoliť najviac "+limit+" položiek";
+            }
+        },
+        formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky..."; },
+        formatSearching: function () { return "Vyhľadávanie..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_sv.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_sv.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 Swedish translation.
+ *
+ * Author: Jens Rantil <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Inga träffar"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
+        formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
+        formatLoadMore: function (pageNumber) { return "Laddar fler resultat..."; },
+        formatSearching: function () { return "Söker..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_th.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_th.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 Thai translation.
+ *
+ * Author: Atsawin Chaowanakritsanakul <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "ไม่พบข้อมูล"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; },
+        formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; },
+        formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม..."; },
+        formatSearching: function () { return "กำลังค้นข้อมูล..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_tr.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_tr.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 Turkish translation.
+ * 
+ * Author: Salim KAYABAŞI <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Sonuç bulunamadı"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
+        formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
+        formatLoadMore: function (pageNumber) { return "Daha fazla..."; },
+        formatSearching: function () { return "Aranıyor..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ua.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_ua.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,17 @@
+/**
+ * Select2 <Language> translation.
+ * 
+ * Author: bigmihail <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Нічого не знайдено"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length, s = ["", "и", "ів"], p = [2,0,1,1,1,2]; return "Введіть буль ласка ще " + n + " символ" + s[ (n%100>4 && n%100<=20)? 2 : p[Math.min(n%10, 5)] ]; },
+        formatInputTooLong: function (input, max) { var n = input.length - max, s = ["", "и", "ів"], p = [2,0,1,1,1,2]; return "Введіть буль ласка на " + n + " символ" + s[ (n%100>4 && n%100<=20)? 2 : p[Math.min(n%10, 5)] ] + " менше"; },
+        formatSelectionTooBig: function (limit) {var s = ["", "и", "ів"], p = [2,0,1,1,1,2];  return "Ви можете вибрати лише " + limit + " елемент" + s[ (limit%100>4 && limit%100<=20)? 2 : p[Math.min(limit%10, 5)] ]; },
+        formatLoadMore: function (pageNumber) { return "Завантаження даних..."; },
+        formatSearching: function () { return "Пошук..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_vi.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_vi.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,18 @@
+/**
+ * Select2 Vietnamese translation.
+ * 
+ * Author: Long Nguyen <[email protected]>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Không tìm thấy kết quả"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả..."; },
+        formatSearching: function () { return "Đang tìm..."; }
+    });
+})(jQuery);
+

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_zh-CN.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_zh-CN.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,14 @@
+/**
+ * Select2 Chinese translation
+ */
+(function ($) {
+    "use strict";
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "没有找到匹配项"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
+        formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
+        formatLoadMore: function (pageNumber) { return "加载结果中..."; },
+        formatSearching: function () { return "搜索中..."; }
+    });
+})(jQuery);

Added: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_zh-TW.js
==============================================================================
--- (empty file)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/resources/select2_locale_zh-TW.js	Mon Oct 28 21:02:22 2013
@@ -0,0 +1,14 @@
+/**
+ * Select2 Traditional Chinese translation
+ */
+(function ($) {
+    "use strict";
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "沒有找到相符的項目"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
+        formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
+        formatLoadMore: function (pageNumber) { return "載入中..."; },
+        formatSearching: function () { return "搜尋中..."; }
+    });
+})(jQuery);

Modified: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/smart_keyword_edit_form.pt
==============================================================================
--- collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/smart_keyword_edit_form.pt	(original)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/smart_keyword_edit_form.pt	Mon Oct 28 21:02:22 2013
@@ -2,6 +2,18 @@
       lang="en"
       metal:use-macro="here/main_template/macros/master"
       i18n:domain="plone">
+  <head>
+<metal:javascript_head_slot fill-slot="javascript_head_slot">
+    <script type="text/javascript"
+        tal:attributes="src string:${context/portal_url}/++resource++collective.smartkeywordmanager/select2.min.js">
+    </script>
+<link rel="stylesheet" type="text/css" media="screen" href="#"
+       tal:attributes="href string:${context/portal_url}/++resource++collective.smartkeywordmanager/select2.css" />
+
+  
+</metal:javascript_head_slot>
+
+  </head>
 
   <body>
 
@@ -13,7 +25,7 @@
           <tal:foldercontents define="b_start request/b_start | python: 0;
                                       b_size request/b_size | view/b_size;
                                       all_keywords view/getAllKeywords;
-                                      folderContents python:here.queryCatalog(b_start=b_start, b_size=b_size);
+                                      folderContents python:context.queryCatalog(b_start=b_start, b_size=b_size);
                                       batch folderContents;">
             <tal:listing condition="folderContents">
 
@@ -33,10 +45,12 @@
               </div>
 
               <form method="post" action="smart-keyword-edit"
+                    accept-charset="utf-8"
                     tal:attributes="action request/getURL">
 
                 <input type="hidden" name="b_start:int" tal:attributes="value b_start" />
                 <input type="hidden" name="b_size:int" tal:attributes="value b_size" />
+                <a name="top" ></a>
 
                 <dl class="collapsible inline collapsedOnClick">
                   <dt i18n:translate="label_all_keywords"
@@ -51,12 +65,12 @@
                       </span>
                     </p>
                     <p>
-                      <span i18n:translate="label_add_all">Add to all</span> :
-                      <input size="40" type="text" name="global_add:list" />
+                      <label i18n:translate="label_add_all" for="global_add">Add to all</label> :
+                      <input type="hidden" name="global_add" id="global_add" />
                     </p>
                     <p>
-                      <span i18n:translate="label_remove_all">Remove to all</span> :
-                      <input size="40" type="text" name="global_remove:list" />
+                      <label i18n:translate="label_remove_all" for="global_remove">Remove from all</label> :
+                      <input type="hidden" name="global_remove" id="global_remove" />
                     </p>
                   </dd>
                 </dl>
@@ -132,17 +146,11 @@
                           <td>
                             <input type="hidden" name="items.uid:records"
                                    tal:attributes="value item/UID" />
-                            <p><span i18n:translate="label_remove">Remove</span> :
-                              <tal:loop tal:repeat="kw item_keywords">
-                                <input type="checkbox" name="items.delete:records:list"
-                                       tal:attributes="value kw"/>
-                                <span tal:replace="kw" />
-                              </tal:loop>
-                            </p>
-                            <p>
-                              <span i18n:translate="label_add">Add</span> :
-                              <input size="40" type="text" name="items.add:records" />
-                            </p>
+                            <input type="hidden" name="items.tags:records:list" id="" tal:attributes="id string:item-${item/UID}; 
+                                                                                         value python:','.join(item.Subject)" />
+
+      <tal:js tal:replace="structure python:view.generate_js(item.UID)" />
+
                           </td>
 
                         </tal:defs>
@@ -150,29 +158,8 @@
                     </tal:items>
                   </tbody>
                 </table>
-
-                <dl class="collapsible inline collapsedOnClick">
-                  <dt i18n:translate="label_all_keywords"
-                      class="collapsibleHeader">
-                    All keywords
-                  </dt>
-                  <dd class="collapsibleContent">
-                    <p>
-                      <span tal:repeat="kw all_keywords">
-                        <span tal:content="kw" />
-                        <span tal:condition="not:repeat/kw/end" tal:content="view/separator" />
-                      </span>
-                    </p>
-                    <p>
-                      <span i18n:translate="label_add_all">Add to all</span> :
-                      <input size="40" type="text" name="global_add:list" />
-                    </p>
-                    <p>
-                      <span i18n:translate="label_remove_all">Remove to all</span> :
-                      <input size="40" type="text" name="global_remove:list" />
-                    </p>
-                  </dd>
-                </dl>
+                <a href="#top" i18n:translate=""
+                   tal:attributes="href string:${request/getURL}#top" >Up</a>
 
                 <p>
                   <br />
@@ -196,6 +183,13 @@
           </tal:foldercontents>
         </metal:listingmacro>
 
+    <script type="text/javascript">
+jQuery(function($) {
+    $("#global_add").select2({tags:[]});
+});
+   </script>
+     <tal:global_remove_js tal:replace="structure view/global_remove_js" />
+
       </metal:main-macro>
     </div>
 

Modified: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/tests.py
==============================================================================
--- collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/tests.py	(original)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/tests.py	Mon Oct 28 21:02:22 2013
@@ -9,7 +9,13 @@
 from Products.PloneTestCase.layer import PloneSite
 ptc.setupPloneSite()
 
+from zope.component import getUtility
+from plone.registry.interfaces import IRegistry
+from zope.publisher.browser import TestRequest
+
+
 import collective.smartkeywordmanager
+from collective.smartkeywordmanager.views import smart_keyword_edit_form_view
 
 
 class TestCase(ptc.PloneTestCase):
@@ -27,8 +33,35 @@
             pass
 
 
+class ProfileTestCase(TestCase):
+
+    def test_action(self):
+        self.assertIn('edit_keywords', self.portal.portal_actions)
+
+    def test_registry_batchsize(self):
+        registry = getUtility(IRegistry)
+        return self.assertEqual(registry['collective.smartkeywordmanager.b_size'], 50)
+
+    def test_registry_separator(self):
+        registry = getUtility(IRegistry)
+        return self.assertEqual(registry['collective.smartkeywordmanager.separator'], ';')
+
+
+class ViewTestCase(TestCase):
+
+
+    def test_cook(self):
+        request = TestRequest()
+        view = smart_keyword_edit_form_view(self.portal, request)
+        print view.cook('abc')
+        print view.cook(['abc', 'foo'])
+
+        
+
 def test_suite():
     return unittest.TestSuite([
+        unittest.makeSuite(ProfileTestCase),
+        unittest.makeSuite(ViewTestCase)
 
         # Unit tests
         #doctestunit.DocFileSuite(

Modified: collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/views.py
==============================================================================
--- collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/views.py	(original)
+++ collective.smartkeywordmanager/trunk/collective/smartkeywordmanager/views.py	Mon Oct 28 21:02:22 2013
@@ -1,8 +1,18 @@
+from types import ListType, TupleType
+
 from Products.Five import BrowserView
 from zope.component import getUtility
 from plone.registry.interfaces import IRegistry
 from Products.CMFCore.utils import getToolByName
 
+SELECT2 = """
+    <script type="text/javascript">
+jQuery(function($) {
+    $("#%(cssid)s").select2({tags:[%(tags)s]});
+
+});
+   </script>
+"""
 
 class smart_keyword_edit_form_view(BrowserView):
     """
@@ -11,80 +21,78 @@
 
     def __init__(self, context, request):
         super(smart_keyword_edit_form_view, self).__init__(context, request)
-        form = self.request.form
         self.registry = getUtility(IRegistry)
+        self.catalog = getToolByName(context, "portal_catalog")
 
-        # Get form data
-        global_add = form.get('global_add', [])
-        global_remove = form.get('global_remove', [])
+    def __call__(self):
+        form = self.request.form
         items = form.get('items', None)
-        b_start = form.get('b_start', 0)
-        b_size = form.get('b_size', self.b_size)
-
-        # Cook tags
-        global_add = self.cook(global_add)
-        global_remove = self.cook(global_remove)
-
+        
         if items:
+	    # Get form data
+	    global_add = form.get('global_add', [])
+	    global_remove = form.get('global_remove', [])
+	    b_start = form.get('b_start', 0)
+	    b_size = form.get('b_size', self.b_size)
+
+	    # Cook tags
+	    global_add = self.cook(global_add)
+	    global_remove = self.cook(global_remove)
 
             # Convert items into dictonnary
             items = dict([ (item["uid"], item) for item in items ])
 
             # Now proceed
             for item in self.context.queryCatalog(b_start=b_start, b_size=b_size):
-                uid = item.UID
-                values = items.get(uid, {})
-                add = values.get("add", "")
-                add = self.cook(add, False)
-                delete = values.get("delete", [])
-                self.modifyKeywords(uid, add + global_add, delete + global_remove)
+                values = items.get(item.UID, {})
+                new_add = values.get('tags', []) + global_add
+                new_kw = tuple([kw for kw in new_add if not kw in global_remove])
+                self.modifyKeywords(item, values, new_kw)
+        return self.index()
 
     def cook(self, what, joinfirst = True):
-        if joinfirst:
+        if joinfirst and type(what) in (ListType, TupleType):
             what = [unicode(kw, 'utf-8') for kw in what]
             what = self.separator.join(what)
         else:
             what = unicode(what, 'utf-8')
         return [kw.encode('utf-8').strip() for kw in what.split(self.separator) if kw.strip()]
 
-    def modifyKeywords(self, uid, add = [], delete = []):
-        """
-        Modify keywords of object
-        """
-        # Shortcut out of dummy calls
-        if not add and not delete:
-            return
+    def generate_js(self, uid):
+        brain = self.getbrain(uid)
+        return SELECT2 % {'cssid': 'item-' + uid,
+                          'tags': ','.join(['"%s"' % item for item in brain.Subject])}
+
+    def global_remove_js(self):
+        return SELECT2 % {'cssid': 'global_remove',
+                          'tags': ','.join(['"%s"' % item for item in self.getAllKeywords()]) }
 
+    def getbrain(self, uid):
         # Get object from catalog
-        catalog = getToolByName(self, "portal_catalog")
-        brains = catalog(UID = uid)
+        brains = self.catalog(UID=uid)
         if len(brains) != 1:
             # Oh, oh, what ?
-            return
-        brain = brains[0]
+            raise ValueError
+        return brains[0]
 
-        # Compute lists of keywords
-        old = tuple(brain.Subject)
-        delete = set(delete)
-        new = [ kw for kw in old if not kw in delete ]
-        existing = set(new)
-        for kw in add:
-            if not kw in existing:
-                new.append(kw)
-        new = tuple(new)
+    def modifyKeywords(self, brain, values, new_kw):
+        """
+        Modify keywords of object
+        """
+        old_kw = tuple(brain.Subject) 
 
         # If anything change, write it
-        if new != old:
+        if new_kw != old_kw:
             obj = brain.getObject()
-            obj.setSubject(new)
+            obj.setSubject(new_kw)
             obj.reindexObject()
 
+    # XXX memoize this
     def getAllKeywords(self):
         """
         Return sorted list of tags
         """
-        catalog = getToolByName(self, "portal_catalog")
-        keywords = list(catalog.uniqueValuesFor('Subject'))
+        keywords = list(self.catalog.uniqueValuesFor('Subject'))
         keywords.sort()
         return keywords
 

Modified: collective.smartkeywordmanager/trunk/docs/HISTORY.txt
==============================================================================
--- collective.smartkeywordmanager/trunk/docs/HISTORY.txt	(original)
+++ collective.smartkeywordmanager/trunk/docs/HISTORY.txt	Mon Oct 28 21:02:22 2013
@@ -6,6 +6,7 @@
 
 - Added view for Collection
 - Fixed UTF-8 encoding bug
+- Use select2 for presenting keywords
 
 
 0.6 (2011-01-04)

------------------------------------------------------------------------------
Android is increasing in popularity, but the open development platform that
developers love is also attractive to malware creators. Download this white
paper to learn more about secure code signing practices that can help keep
Android apps secure.
http://pubads.g.doubleclick.net/gampad/clk?id=65839951&iu=/4140/ostg.clktrk
_______________________________________________
Collective-checkins mailing list
[email protected]
https://lists.sourceforge.net/lists/listinfo/collective-checkins